- Methyldiallylamine
-
- $10.00 / 1KG
-
2026-03-20
- CAS:2424-01-3
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 10 mt
- Methyldiallylamine
-
- $0.00 / 1KG
-
2025-06-27
- CAS:2424-01-3
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 500000kg
- Methyldiallylamine
-
- $0.00 / 1kg
-
2025-06-20
- CAS:2424-01-3
- Min. Order: 1kg
- Purity: 0.99
- Supply Ability: 20 tons
|
| | Methyldiallylamine Basic information |
| Product Name: | Methyldiallylamine | | Synonyms: | N,N-DIALLYLMETHYLAMINE;N-METHYLDIALLYLAMINE;2-Propen-1-amine, N-methyl-N-2-propenyl-;N,N-Di(2-propenyl)-N-methylamine;N-Allyl-N-methyl-2-propen-1-amine;n-methyl-n-2-propenyl-2-propen-1-amin;N-methyl-N-2-propenyl-2-Propen-1-amine;DIALLYLMETHYLAMINE | | CAS: | 2424-01-3 | | MF: | C7H13N | | MW: | 111.18 | | EINECS: | 219-354-4 | | Product Categories: | monomer;Acyclic;Alkenes;Organic Building Blocks | | Mol File: | 2424-01-3.mol |  |
| | Methyldiallylamine Chemical Properties |
| Melting point | 112 °C | | Boiling point | 111 °C (lit.) | | density | 0.789 g/mL at 25 °C (lit.) | | vapor pressure | 25.6hPa at 20℃ | | refractive index | n20/D 1.43(lit.) | | Fp | 45 °F | | storage temp. | 2-8°C, sealed storage, away from moisture | | pka | 8.01±0.50(Predicted) | | form | Liquid | | Specific Gravity | 0.769 | | Appearance | Colorless to light yellow Liquid | | InChI | InChI=1S/C7H13N/c1-4-6-8(3)7-5-2/h4-5H,1-2,6-7H2,3H3 | | InChIKey | WGESLFUSXZBFQF-UHFFFAOYSA-N | | SMILES | C(N(C)CC=C)C=C | | CAS DataBase Reference | 2424-01-3(CAS DataBase Reference) | | NIST Chemistry Reference | Methyldiallylamine(2424-01-3) | | EPA Substance Registry System | 2-Propen-1-amine, N-methyl-N-2-propenyl- (2424-01-3) |
| Hazard Codes | F,C | | Risk Statements | 11-34 | | Safety Statements | 16-26-36/37/39-45 | | RIDADR | UN 2733 3/PG 2 | | WGK Germany | 3 | | TSCA | TSCA listed | | REACH Registrations | Active | | HazardClass | 3, 8 | | HS Code | 2921199990 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Flam. Liq. 2
Skin Corr. 1B |
| | Methyldiallylamine Usage And Synthesis |
| Uses | Diallylmethylamine may be used in the synthesis of the following:
- diallyldimethylammonium iodide
- diallylethylmethylammonium bromide
- diallylbenzylmethylammonium chloride
- alkyl substituted diallylmethyl quaternary ammonium salt monomers
| | General Description | Diallylmethylamine is a tertiary amine. It can be prepared from the reaction between aqueous methylamine and allylchloride in the presence of polyglycol-400 (phase transfer catalyst). |
| | Methyldiallylamine Preparation Products And Raw materials |
|