|
|
| | BISTRIFLUOROACETAMIDE Basic information |
| Product Name: | BISTRIFLUOROACETAMIDE | | Synonyms: | Diacetamide, 2,2,2,2',2',2'-hexafluoro-;BTFA;BISTRIFLUOROACETAMIDE;2,2,2-trifluoro-N-(trifluoroacetyl)acetamide;Bis(trifluoroacetyl)amine;2,2,2-trifluoro-N-(2,2,2-trifluoroacetyl)acetamide;N-(phenylmethyl)formamide;Bistrifluoroacetamide > | | CAS: | 407-24-9 | | MF: | C4HF6NO2 | | MW: | 209.05 | | EINECS: | 206-981-3 | | Product Categories: | Acylation (GC Derivatizing Reagents);Analytical Chemistry;GC Derivatizing Reagents | | Mol File: | 407-24-9.mol |  |
| | BISTRIFLUOROACETAMIDE Chemical Properties |
| Melting point | 80-86 °C | | Boiling point | 120 °C / 1mmHg | | density | 1.603±0.06 g/cm3(Predicted) | | solubility | almost transparency in hot Toluene | | pka | 3.04±0.46(Predicted) | | form | powder to crystal | | color | White to Almost white | | BRN | 1793118 | | InChI | 1S/C4HF6NO2/c5-3(6,7)1(12)11-2(13)4(8,9)10/h(H,11,12,13) | | InChIKey | GMQVFHZSXKJCIV-UHFFFAOYSA-N | | SMILES | FC(F)(F)C(=O)NC(=O)C(F)(F)F | | CAS DataBase Reference | 407-24-9(CAS DataBase Reference) | | EPA Substance Registry System | Perfluorodiacetamide (407-24-9) |
| Hazard Codes | C | | Risk Statements | 36/37/38-36/38 | | Safety Statements | 26-36/37/39 | | RIDADR | UN 3261 8/PG 2 | | WGK Germany | 3 | | F | 3-10-21 | | HazardClass | 8 | | PackingGroup | III | | HS Code | 29251900 | | Storage Class | 11 - Combustible Solids |
| | BISTRIFLUOROACETAMIDE Usage And Synthesis |
| Purification Methods | A major impurity is trifluoroacetamide. Add trifluoroacetic anhydride to BTFA, reflux for 2hours and fractionate using a Vigreux column (p 11) at atmospheric pressure. [Donike J Chromatogr 78 273 1973, Beilstein 2 IV 471.] |
| | BISTRIFLUOROACETAMIDE Preparation Products And Raw materials |
|