- (ZE)-SU9516
-
- $55.00 / 1mg
-
2026-01-09
- CAS:666837-93-0
- Min. Order:
- Purity: 99.91%
- Supply Ability: 10g
- SU 9516
-
- $1.00 / 1g
-
2019-12-24
- CAS:666837-93-0
- Min. Order: 1g
- Purity: 99%
- Supply Ability: 20kg
|
| | SU 9516 Basic information |
| Product Name: | SU 9516 | | Synonyms: | SU 9516;3-[1-(3H-IMIDAZOL-4-YL)-METH-(Z)-YLIDENE]-5-METHOXY-1,3-DIHYDRO-INDOL-2-ONE;(Z)-3-((1H-iMidazol-5-yl)Methylene)-5-Methoxyindolin-2-one;1,3-Dihydro-3-(1H-imidazol-5-ylmethylene)-5-methoxy-2H-indol-2-one;SU 9516;SU9516;(Z)-3-((1H-IMIDAZOL-5-YL)METHYLENE)-5-METHOXYINDOLIN-2-ONE;3-((1H-Imidazol-5-yl)methylene)-5-methoxyindolin-2-one;2H-Indol-2-one, 1,3-dihydro-3-(1H-imidazol-5-ylmethylene)-5-methoxy-;(E/Z)-SU9516 | | CAS: | 666837-93-0 | | MF: | C13H11N3O2 | | MW: | 241.25 | | EINECS: | | | Product Categories: | | | Mol File: | Mol File |  |
| | SU 9516 Chemical Properties |
| Boiling point | 601.5±55.0 °C(Predicted) | | density | 1.383±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | DMSO: ~17 mg/mL | | form | crystalline | | pka | 11?+-.0.20(Predicted) | | color | brown | | InChI | 1S/C13H11N3O2/c1-18-9-2-3-12-10(5-9)11(13(17)16-12)4-8-6-14-7-15-8/h2-7H,1H3,(H,14,15)(H,16,17) | | InChIKey | QNUKRWAIZMBVCU-UHFFFAOYSA-N | | SMILES | [nH]1cncc1C=C2c3c(ccc(c3)OC)NC2=O |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | SU 9516 Usage And Synthesis |
| Uses | SU9516 is a selectively potent ATP-competitive inhibitor of CDKs. | | Uses | SU 9516 is a 3-substituted indolinone CDK inhibitor with potent and selective inhibition towards cyclin-dependant kinases. | | Definition | ChEBI: 3-(1H-imidazol-5-ylmethylidene)-5-methoxy-1H-indol-2-one is a member of indoles. | | Biological Activity | Cell permeable: yes', 'Primary Target
Cdk2/A', 'Product competes with ATP.', 'Reversible: yes', 'Target IC50: 22 nM for Cdk2/A; 40 nM for Cdk1/B; 200 nM for Cdk4/D1 |
| | SU 9516 Preparation Products And Raw materials |
|