|
|
| | 2',4',6'-TRIMETHYLACETOPHENONE Basic information |
| Product Name: | 2',4',6'-TRIMETHYLACETOPHENONE | | Synonyms: | Methylmesitylketone;2',4',6'-Trimethylacetophenone 2-Acetylmesitylene;2,4,6-Trimethylacetophenone, 98+%;2,4,6-TRIMETHYLACETOPHENONE;2',4',6'-TRIMETHYLBENZOYL METHIDE;(2,4,6-TRIMETHYLPHENYL)ETHANONE;2',4',6'-TRIMETHYLMETHYL PHENYL KETONE;2-ACETYLMESITYLENE | | CAS: | 1667-01-2 | | MF: | C11H14O | | MW: | 162.23 | | EINECS: | 216-783-9 | | Product Categories: | Aromatic Acetophenones & Derivatives (substituted) | | Mol File: | 1667-01-2.mol |  |
| | 2',4',6'-TRIMETHYLACETOPHENONE Chemical Properties |
| Boiling point | 235-236 °C(lit.) | | density | 0.975 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.517(lit.) | | Fp | >230 °F | | storage temp. | Store below +30°C. | | solubility | Difficult to mix. | | form | clear liquid | | color | Colorless to Light yellow to Light orange | | Specific Gravity | 0.98 | | Odor Type | Peculiar, strong and persistent odor, simultaneously non-floral and heavy-sweet-floral. Not nearly as pungent as Acetophenone, but still rather chemical in its general character. | | BRN | 2044595 | | InChI | InChI=1S/C11H14O/c1-7-5-8(2)11(10(4)12)9(3)6-7/h5-6H,1-4H3 | | InChIKey | XWCIICLTKWRWCI-UHFFFAOYSA-N | | SMILES | C(=O)(C1=C(C)C=C(C)C=C1C)C | | CAS DataBase Reference | 1667-01-2(CAS DataBase Reference) | | EPA Substance Registry System | 2',4',6'-Trimethylacetophenone (1667-01-2) |
| Safety Statements | 23-24/25 | | WGK Germany | 3 | | TSCA | TSCA listed | | HS Code | 29143990 |
| | 2',4',6'-TRIMETHYLACETOPHENONE Usage And Synthesis |
| Chemical Properties | CLEAR COLOURLESS TO LIGHT YELLOW LIQUID | | Chemical Properties |
Colorless liquid, insoluble in water, soluble in alcohol and perfume materials.
| | Uses | 2',4',6'-Trimethylacetophenone is used as laboratory chemicals, manufacture of substances and intermediated for chemical synthesis. | | Application |
Could be used in perfumery as a modifier for basic components in New Mown Hay, Fougere, heavy florals, etc., and blends well with Labdanum, Nitromusks, Benzoates and Cinnamates, Cournarins, etc.
|
| | 2',4',6'-TRIMETHYLACETOPHENONE Preparation Products And Raw materials |
|