|
|
| | 1H-Imidazole-4-carboxylic acid Basic information |
| | 1H-Imidazole-4-carboxylic acid Chemical Properties |
| Melting point | 294-295 °C (lit.) | | Boiling point | 495.0±18.0 °C(Predicted) | | density | 1.524±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | Aqueous Acid (sparingly) | | form | Liquid | | pka | 2.69±0.10(Predicted) | | color | Clear colorless | | InChI | InChI=1S/C4H4N2O2/c7-4(8)3-1-5-2-6-3/h1-2H,(H,5,6)(H,7,8) | | InChIKey | NKWCGTOZTHZDHB-UHFFFAOYSA-N | | SMILES | C1NC(C(O)=O)=CN=1 | | CAS DataBase Reference | 1072-84-0(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36-37/39 | | WGK Germany | 3 | | RTECS | NI4001000 | | HazardClass | IRRITANT | | HS Code | 29332900 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 1H-Imidazole-4-carboxylic acid Usage And Synthesis |
| Chemical Properties | Gray or tan powder | | Uses | 4-Imidazolecarboxylic acid (ICA) was used in the synthesis of triphenymethyl-protected 4-imidazole carboxylic acid (trityl-ImCOOH) which is employed to functionalize poly(propylene imine) dendrimers. It may be used in the following studies:
- In the synthesis of lanthanide sulfate–carboxylates, [Ln(HIMC)(SO4)(H2O)] (Ln = Dy and Eu, HIMC = 4-imidazolecarboxylic acid) by in situ decarboxylation in the presence of Cu(II) ions.
- As an internal standard to obtain calibration curve by plotting the peak area ratios of histamine (HA) and several metabolites isolated from C3H/HeNCrj mice hair relative to ICA.
- In the synthesis of tetranuclear manganese carboxylate complexes possessing imidazole-based N/O chelating ligands.
| | General Description | 4-Imidazolecarboxylic acid (1H-imidazole-4-carboxylic acid, H2imc) is an imidazole derivative that contains an imidazole group and a carboxylate group. It has been widely utilized to generate different types of coordination polymers. The anion of 4-imidazolecarboxylic acid has been reported to stabilize binuclear hydroxo complexes of trivalent lanthanides in the pH range 7-10. | | Synthesis | 1. ethyl imidazole-4-carboxylate was mixed with potassium hydroxide solution at a mass ratio of 1:2.2, and the reaction was carried out at 30 °C. 2. After the reaction was completed, sulfuric acid solution was added slowly to adjust the pH of the reaction mixture to 1. 3. The crude product was purified by recrystallization to obtain 1H-imidazole-4-carboxylic acid. | | References | [1] Patent: CN105693619, 2016, A. Location in patent: Paragraph 0010; 0088; 0089 [2] Patent: CN105622518, 2016, A. Location in patent: Paragraph 0083; 0094; 0095; 0096; 0097 [3] Patent: CN105622515, 2016, A. Location in patent: Paragraph 0074; 0075 |
| | 1H-Imidazole-4-carboxylic acid Preparation Products And Raw materials |
|