|
|
| | 2-Bromo-4-methoxy-5-benzyloxybenzoic acid Basic information |
| | 2-Bromo-4-methoxy-5-benzyloxybenzoic acid Chemical Properties |
| Melting point | 193.0 to 197.0 °C | | Boiling point | 445.4±45.0 °C(Predicted) | | density | 1.486±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | form | powder to crystal | | pka | 2.97±0.10(Predicted) | | color | White to Light yellow | | InChI | InChI=1S/C15H13BrO4/c1-19-13-8-12(16)11(15(17)18)7-14(13)20-9-10-5-3-2-4-6-10/h2-8H,9H2,1H3,(H,17,18) | | InChIKey | FBTDEMXQQIWHKX-UHFFFAOYSA-N | | SMILES | C(O)(=O)C1=CC(OCC2=CC=CC=C2)=C(OC)C=C1Br | | CAS DataBase Reference | 24958-42-7(CAS DataBase Reference) |
| | 2-Bromo-4-methoxy-5-benzyloxybenzoic acid Usage And Synthesis |
| Uses | 2-Bromo-5-benzyloxy-4-methoxybenzoic Acid is an intermediate in the synthesis of 3,8-Dihydroxy-9-methoxy-6H-Dibenzo[b,d]pyran-6-one (D455545) which has been used in anti-wrinkle agents and is known as a collagen production promoter, MMP-1 production inhibitor and elastase activity inhibitor containing urolithin. |
| | 2-Bromo-4-methoxy-5-benzyloxybenzoic acid Preparation Products And Raw materials |
|