|
|
| | 2,2-Bis(4-methylphenyl)hexafluoropropane Basic information |
| Product Name: | 2,2-Bis(4-methylphenyl)hexafluoropropane | | Synonyms: | BIS-T-AF;2,2-Bis(4-methylphenyl)hexafluoropropane 98%;2,2-Bis(4-methylphenyl)hexafluoropropane98%;1,1,1,3,3,3-Hexafluoro-2,2-bis(4-methylphenyl)propane;2,2-Bis(4-methylphenyl)-1,1,1,3,3,3-hexafluoropropane;4,4'-[Bis(trifluoromethyl)methylene]bistoluene;4,4'-Bis(trifluoromethyl)methylenebistoluene;4,4'-(Hexafluoroisopropylidene)ditoluene,98% | | CAS: | 1095-77-8 | | MF: | C17H14F6 | | MW: | 332.28 | | EINECS: | | | Product Categories: | | | Mol File: | 1095-77-8.mol |  |
| | 2,2-Bis(4-methylphenyl)hexafluoropropane Chemical Properties |
| Melting point | 82 °C | | Boiling point | 117°C/2mm | | density | 1.1865 (rough estimate) | | refractive index | 1.4250 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | form | powder to crystal | | color | White to Light yellow | | InChI | InChI=1S/C17H14F6/c1-11-3-7-13(8-4-11)15(16(18,19)20,17(21,22)23)14-9-5-12(2)6-10-14/h3-10H,1-2H3 | | InChIKey | OWEIAGSMFHSSES-UHFFFAOYSA-N | | SMILES | C(C1=CC=C(C)C=C1)(C1=CC=C(C)C=C1)(C(F)(F)F)C(F)(F)F | | CAS DataBase Reference | 1095-77-8(CAS DataBase Reference) |
| Hazard Codes | Xi | | HazardClass | IRRITANT | | HS Code | 2903998090 |
| | 2,2-Bis(4-methylphenyl)hexafluoropropane Usage And Synthesis |
| Chemical Properties | White powder | | Uses | 2,2-Bis(4-methylphenyl)hexafluoropropane is used as an intermediate in the synthesis of fluorinated bifunctional monomers. |
| | 2,2-Bis(4-methylphenyl)hexafluoropropane Preparation Products And Raw materials |
|