|
|
| | 1,2-Dimethyl-4-fluorobenzene Basic information |
| Product Name: | 1,2-Dimethyl-4-fluorobenzene | | Synonyms: | 3,4-DIMETHYLFLUOROBENZENE;4-FLUORO-O-XYLENE;4-FLUORO-1,2-DIMETHYLBENZENE;4-FLUORO-1,2-XYLENE;1-FLUORO-3,4-DIMETHYLBENZENE;1,2-DIMETHYL-4-FLUOROBENZENE;1,2-Dimethyl-4-fluorobenzene~3,4-Dimethylfluorobenzene;4-Fluoro-o-xylene,1,2-Dimethyl-4-fluoroBenzene | | CAS: | 452-64-2 | | MF: | C8H9F | | MW: | 124.16 | | EINECS: | 670-462-1 | | Product Categories: | Fluorine series | | Mol File: | 452-64-2.mol |  |
| | 1,2-Dimethyl-4-fluorobenzene Chemical Properties |
| Boiling point | 148-150 °C | | density | 1 | | refractive index | 1.4805-1.4825 | | Fp | 40 °C | | storage temp. | Sealed in dry,Room Temperature | | form | liquid | | color | clear colourless | | BRN | 1856457 | | InChI | InChI=1S/C8H9F/c1-6-3-4-8(9)5-7(6)2/h3-5H,1-2H3 | | InChIKey | WYHBENDEZDFJNU-UHFFFAOYSA-N | | SMILES | C1(C)=CC=C(F)C=C1C | | CAS DataBase Reference | 452-64-2(CAS DataBase Reference) |
| Hazard Codes | F,Xi | | Risk Statements | 10-37 | | Safety Statements | 16 | | RIDADR | 1993 | | Hazard Note | Flammable | | HazardClass | 3 | | PackingGroup | III | | HS Code | 29039990 |
| | 1,2-Dimethyl-4-fluorobenzene Usage And Synthesis |
| Chemical Properties | clear colorless to light yellow liquid |
| | 1,2-Dimethyl-4-fluorobenzene Preparation Products And Raw materials |
|