|
|
| | 1-[(2RS)-2-Benzyloxy-2-(2,4-dichlor Basic information |
| Product Name: | 1-[(2RS)-2-Benzyloxy-2-(2,4-dichlor | | Synonyms: | 1-[(2RS)-2-Benzyloxy-2-(2,4-dichlor;Nitrate 1-[2-(Benzyloxy)-2-(2,4-dichlorophenyl)ethyl]-1H-imidazole nitrate;Miconazole Impurity H as Nitrate;Miconazole Nitrate Impurity H as Nitrate;Miconazole EP Impurity H as Nitrate;Miconazole Nitrate EP Impurity H as Nitrate;Miconazole Impurity 8 Nitrate (Miconazole EP Impurity H Nitrate);1-[(2RS)-2-Benzyloxy-2-(2,4-dichlorophenyl)ethyl]-1H-imidazole Nitrate | | CAS: | 203264-09-9 | | MF: | C18H17Cl2N3O4 | | MW: | 410.25 | | EINECS: | | | Product Categories: | | | Mol File: | 203264-09-9.mol |  |
| | 1-[(2RS)-2-Benzyloxy-2-(2,4-dichlor Chemical Properties |
| storage temp. | 2-8°C | | Major Application | pharmaceutical small molecule | | InChIKey | LWUSMMBQCGNXTQ-UHFFFAOYSA-N | | SMILES | ClC1=CC(Cl)=CC=C1C(OCC2=CC=CC=C2)CN3C=NC=C3.[O-][N+](O)=O |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | 1-[(2RS)-2-Benzyloxy-2-(2,4-dichlor Usage And Synthesis |
| Uses | These Reference Materials are suitable for use in several analytical applications including, but not limited to, method development for qualitative and quantitative analyses, daily calibration, and routine quality control testing. |
| | 1-[(2RS)-2-Benzyloxy-2-(2,4-dichlor Preparation Products And Raw materials |
|