| Company Name: |
TOSUN PHARM Gold |
| Tel: |
020-66392521-118 18922260391 |
| Email: |
3004261881@qq.com |
| Company Name: |
BOC Sciences |
| Tel: |
1-631-485-4226; 16314854226 |
| Email: |
info@bocsci.com |
Ilaprazole Impurity 23 manufacturers
|
| | Ilaprazole Impurity 23 Basic information |
| Product Name: | Ilaprazole Impurity 23 | | Synonyms: | Ilaprazole Impurity 23;Epratuzumab impurity 19;Eprazolimide Impurity N;Ilaprazole Impurity 54 Chloride;Epratuzumab impurity | | CAS: | 2285346-40-7 | | MF: | C19H18N4OS | | MW: | 350.44 | | EINECS: | | | Product Categories: | | | Mol File: | 2285346-40-7.mol |  |
| | Ilaprazole Impurity 23 Chemical Properties |
| InChI | InChI=1S/C19H18N4OS/c1-13-17(12-25)23(10-7-18(13)24-2)19-20-15-6-5-14(11-16(15)21-19)22-8-3-4-9-22/h3-11H,12H2,1-2H3,(H-,20,21,25) | | InChIKey | RNUKNDMAEHKCFJ-UHFFFAOYSA-N | | SMILES | C(C1=C(C(OC)=CC=[N+]1C1=NC2=CC=C(N3C=CC=C3)C=C2N1)C)[S-] |
| | Ilaprazole Impurity 23 Usage And Synthesis |
| | Ilaprazole Impurity 23 Preparation Products And Raw materials |
|