| Company Name: |
SunaTech Inc. |
| Tel: |
0512-62872180 18994314770 |
| Email: |
sales@sunatech.com |
|
| | 2',3':5,6]benzo[1,2-c][1,2,5]thiadiazole Basic information |
| Product Name: | 2',3':5,6]benzo[1,2-c][1,2,5]thiadiazole | | Synonyms: | 5,8-Bis(5-bromo-4-(2-butyloctyl)thiophen-2-yl)dithieno[3',2':3,4;Dithieno[3,2-e:2',3'-g]-2,1,3-benzothiadiazole, 5,8-bis[5-bromo-4-(2-butyloctyl)-2-thienyl]-;5,8-bis (5-bromo-4- (2-butyl octyl) thiophenyl) dithiopheno [3 ', 2': 3,4;2',3':5,6]benzo[1,2-c][1,2,5]thiadiazole;5,8-bis(5-bromo-4-(2-butyloctyl)thiophen-2-yl)dithieno[3',2':3,4 | | CAS: | 2433725-51-8 | | MF: | C42H54Br2N2S5 | | MW: | 907.02 | | EINECS: | | | Product Categories: | | | Mol File: | 2433725-51-8.mol | ![2',3':5,6]benzo[1,2-c][1,2,5]thiadiazole Structure](CAS/20210111/GIF/2433725-51-8.gif) |
| | 2',3':5,6]benzo[1,2-c][1,2,5]thiadiazole Chemical Properties |
| Boiling point | 828.9±60.0 °C(Predicted) | | density | 1.323±0.06 g/cm3(Predicted) | | form | powder/crystal | | pka | -2.92±0.30(Predicted) | | color | Orange | | InChIKey | LRYLVBFSNDXVDD-UHFFFAOYSA-N | | SMILES | N1=C2C3C=C(C4SC(Br)=C(CC(CCCC)CCCCCC)C=4)SC=3C3SC(C4SC(Br)=C(CC(CCCC)CCCCCC)C=4)=CC=3C2=NS1 |
| | 2',3':5,6]benzo[1,2-c][1,2,5]thiadiazole Usage And Synthesis |
| Description | D18-2Br has arigid electron accepting dithienobezothiadiazole (DTBT) core with two electron-donating 5-bromo-4-butyloctylthiophene units. The large side alkyl chains are there to promote solubility for solution processing of the end products that acquire D18-2Br as building block. |
| | 2',3':5,6]benzo[1,2-c][1,2,5]thiadiazole Preparation Products And Raw materials |
|