|
1,6,11,16,22,27-Hexaazacyclodotriacontane-2,5,12,15,23,26-hexone, 1,11,22-trihydroxy- Suppliers list
|
| Company Name: |
Energy Chemical |
| Tel: |
021-58432009 400-005-6266 |
| Email: |
marketing@energy-chemical.com |
|
| | 1,6,11,16,22,27-Hexaazacyclodotriacontane-2,5,12,15,23,26-hexone, 1,11,22-trihydroxy- Basic information |
| Product Name: | 1,6,11,16,22,27-Hexaazacyclodotriacontane-2,5,12,15,23,26-hexone, 1,11,22-trihydroxy- | | Synonyms: | 1,6,11,16,22,27-Hexaazacyclodotriacontane-2,5,12,15,23,26-hexone, 1,11,22-trihydroxy-;Proferrioxamine-D2 >=95% (LC/MS-ELSD);Proferrioxamine-D2 | | CAS: | 126988-91-8 | | MF: | C26H46N6O9 | | MW: | 586.68 | | EINECS: | | | Product Categories: | | | Mol File: | 126988-91-8.mol |  |
| | 1,6,11,16,22,27-Hexaazacyclodotriacontane-2,5,12,15,23,26-hexone, 1,11,22-trihydroxy- Chemical Properties |
| Melting point | 179-181 °C | | density | 1.175±0.06 g/cm3(Predicted) | | storage temp. | -20°C | | solubility | DMSO: 1mg/mL | | form | solid | | pka | 9.10±0.20(Predicted) | | Major Application | metabolomics
vitamins, nutraceuticals, and natural products | | InChIKey | SXTGVXKFOVZYIK-UHFFFAOYSA-N | | SMILES | O=C(NCCCCCN(C(CC1)=O)O)CCC(N(CCCCCNC(CCC(N(CCCCNC1=O)O)=O)=O)O)=O |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | 1,6,11,16,22,27-Hexaazacyclodotriacontane-2,5,12,15,23,26-hexone, 1,11,22-trihydroxy- Usage And Synthesis |
| Uses | metabolomics
vitamins, nutraceuticals, and natural products | | Definition | ChEBI: 1,11,22-Trihydroxy-1,6,11,16,22,27-hexazacyclodotriacontane-2,5,12,15,23,26-hexone is a keratan 6'-sulfate and an azamacrocycle. |
| | 1,6,11,16,22,27-Hexaazacyclodotriacontane-2,5,12,15,23,26-hexone, 1,11,22-trihydroxy- Preparation Products And Raw materials |
|