| Company Name: |
Jinan blalong chemical co. LTD
|
| Tel: |
2710913286@qq.com |
| Email: |
1513643261@qq.com |
| Products Intro: |
Product Name:MetaraminolImpurity24 CAS:26988-39-6 Purity:99% HPLC Package:50G;10G;1G;500MG;100MG
|
| Company Name: |
Hubei Xinyang Medical Technology Co., Ltd
|
| Tel: |
15347293736 |
| Email: |
2853117764@yongstandards.com |
| Products Intro: |
Product Name:1,1'-Biphenyl, 3,3'-bis(phenylmethoxy)- CAS:26988-39-6 Purity:99% HPLC Package:10mg;25mg;50mg;100mg;200mg;500mg
|
| Company Name: |
Molcoo Chemicals Inc.
|
| Tel: |
18627923403 |
| Email: |
3001039764@qq.com |
| Products Intro: |
Product Name:Metaraminol bitartrate Impurity 42 CAS:26988-39-6 Purity:95% Package:20mg;50mg;100mg
|
1,1'-Biphenyl, 3,3'-bis(phenylmethoxy)- manufacturers
|
| | 1,1'-Biphenyl, 3,3'-bis(phenylmethoxy)- Basic information |
| | 1,1'-Biphenyl, 3,3'-bis(phenylmethoxy)- Chemical Properties |
| Boiling point | 527.8±35.0 °C(Predicted) | | density | 1.130±0.06 g/cm3(Predicted) | | InChI | InChI=1S/C26H22O2/c1-3-9-21(10-4-1)19-27-25-15-7-13-23(17-25)24-14-8-16-26(18-24)28-20-22-11-5-2-6-12-22/h1-18H,19-20H2 | | InChIKey | OCTKIAPNJUMTAC-UHFFFAOYSA-N | | SMILES | C1(C2=CC=CC(OCC3=CC=CC=C3)=C2)=CC=CC(OCC2=CC=CC=C2)=C1 |
| | 1,1'-Biphenyl, 3,3'-bis(phenylmethoxy)- Usage And Synthesis |
| | 1,1'-Biphenyl, 3,3'-bis(phenylmethoxy)- Preparation Products And Raw materials |
|