| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 3-Pyridinecarboxylic acid, 4-amino-6-chloro-5-fluoro-, ethyl ester Basic information | | Uses |
| Product Name: | 3-Pyridinecarboxylic acid, 4-amino-6-chloro-5-fluoro-, ethyl ester | | Synonyms: | 3-Pyridinecarboxylic acid, 4-amino-6-chloro-5-fluoro-, ethyl ester;ethyl 4-amino-6-chloro-5-fluoropyridine-3-carboxylate;4-amino-6-chloro-5-fluoro-ethyl ester;fluoropyridine-S-carboxylate;ethyl 4-amino-6-chloro-5-fluoropyridine-3-carboxylate - [AC78242];4-Amino-6-chloro-5-fluoro nicotinic acid ethyl ester | | CAS: | 2454397-74-9 | | MF: | C8H8ClFN2O2 | | MW: | 218.61 | | EINECS: | | | Product Categories: | | | Mol File: | 2454397-74-9.mol |  |
| | 3-Pyridinecarboxylic acid, 4-amino-6-chloro-5-fluoro-, ethyl ester Chemical Properties |
| Boiling point | 322.3±42.0 °C(Predicted) | | density | 1.405±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C, protect from light | | pka | 0.73±0.50(Predicted) | | Appearance | Off-white to light yellow Solid | | InChI | InChI=1S/C8H8ClFN2O2/c1-2-14-8(13)4-3-12-7(9)5(10)6(4)11/h3H,2H2,1H3,(H2,11,12) | | InChIKey | BYIJYBRHUZZBLR-UHFFFAOYSA-N | | SMILES | C1=NC(Cl)=C(F)C(N)=C1C(OCC)=O |
| | 3-Pyridinecarboxylic acid, 4-amino-6-chloro-5-fluoro-, ethyl ester Usage And Synthesis |
| Uses | 4-Amino-6-chloro-5-fluoronicotinic acid ethyl ester is a carboxylic acid ester derivative that can be used as a pharmaceutical intermediate. |
| | 3-Pyridinecarboxylic acid, 4-amino-6-chloro-5-fluoro-, ethyl ester Preparation Products And Raw materials |
|