|
|
| | 11-alpha-Hydroxycarvenone Basic information |
| Product Name: | 11-alpha-Hydroxycarvenone | | Synonyms: | 11-alpha-Hydroxycarvenone;(11a,17a)-11,17-dihydroxy-3-oxo-pregna-4,6-diene-21-carboxylic acid;11-HYDROXY-CANRENONE;11Alpha-HydroxyCanrenone;3-(3-OXO-11A,17SS-DIHYDROXY-4,6-DIENE-PREGNA-17A-YL)PROPANOIC ACID LACTONE;3-(3-oxo-11a,17-dihydroxy-4,6-diene-pregna-17a-yl)propanoicacidlactone;11-ALPHA-HYDROXY-CARNRENONE;Pregna-4,6-diene-21-carboxylic acid, 11,17-dihydroxy-3-oxo-, γ-lactone, (11α,17α)- | | CAS: | 192569-17-8 | | MF: | C22H28O4 | | MW: | 356.46 | | EINECS: | 606-276-4 | | Product Categories: | Intermediates & Fine Chemicals;Pharmaceuticals;Steroids;192569-17-8 | | Mol File: | 192569-17-8.mol |  |
| | 11-alpha-Hydroxycarvenone Chemical Properties |
| Melting point | 232-234°C | | Boiling point | 584.7±50.0 °C(Predicted) | | density | 1.25 | | storage temp. | -20°C Freezer | | solubility | Chloroform (Slightly), Methanol (Slightly) | | pka | 14.55±0.60(Predicted) | | form | Solid | | color | Pale Yellow to Brown | | InChIKey | RJTDWMKVQUPGSY-IPRJTMRINA-N | | SMILES | C[C@]12C[C@@H](O)[C@]3([H])[C@]4(CCC(=O)C=C4C=C[C@@]3([H])[C@]1([H])CC[C@]12CCC(=O)O1)C |&1:1,3,5,7,16,18,22,r| | | CAS DataBase Reference | 192569-17-8(CAS DataBase Reference) |
| | 11-alpha-Hydroxycarvenone Usage And Synthesis |
| Chemical Properties | Yellow Crystalline Solid | | Uses | 11α-Hydroxy Canrenone is the key intermediate in the synthesis of Eplerenone, a cardiovascular drug. Canrenone was biotransformed into 11α-Hydroxycanrenone by Aspergillus ochraceus SIT34205. |
| | 11-alpha-Hydroxycarvenone Preparation Products And Raw materials |
|