|
|
| | 2-(2-METHYL-4-NITRO-IMIDAZOL-1-YL)-ETHANOL Basic information |
| Product Name: | 2-(2-METHYL-4-NITRO-IMIDAZOL-1-YL)-ETHANOL | | Synonyms: | 1-(2-Hydroxyethyl)-2-methyl-4-nitroimidazole;2-(2-Methyl-4-nitro-1-imidazolyl)ethanol;2-Methyl-4-nitro-1H-imidazole-1-ethanol;Isometronidazol;RP 8979;2-(2-methyl-4-nitro-1H-imidazol-1-yl)ethanol;2-Methyl-4-nitroimidazole-1-ethanol;Imidazole-1-ethanol, 2-methyl-4-nitro- | | CAS: | 705-19-1 | | MF: | C6H9N3O3 | | MW: | 171.15 | | EINECS: | | | Product Categories: | | | Mol File: | 705-19-1.mol |  |
| | 2-(2-METHYL-4-NITRO-IMIDAZOL-1-YL)-ETHANOL Chemical Properties |
| Melting point | 140 °C | | Boiling point | 405.4±25.0 °C(Predicted) | | density | 1.45±0.1 g/cm3(Predicted) | | storage temp. | Refrigerator | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | pka | 14.44±0.10(Predicted) | | color | Off-White to Orange | | Major Application | pharmaceutical | | InChI | 1S/C6H9N3O3/c1-5-7-6(9(11)12)4-8(5)2-3-10/h4,10H,2-3H2,1H3 | | InChIKey | RSXWJXPKLRYMHW-UHFFFAOYSA-N | | SMILES | [N+](=O)([O-])c1nc([n](c1)CCO)C |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | 2-(2-METHYL-4-NITRO-IMIDAZOL-1-YL)-ETHANOL Usage And Synthesis |
| Uses | Isometronidazole (Metronidazole EP Impurity E) is an impurity of Metronidazole (M338880), a chemotherapeutic agent that is used as a first line defense against Clostridium difficile (C.diff). Isometronidazole is also a hypoxic cell sensitizer in humans and mice. |
| | 2-(2-METHYL-4-NITRO-IMIDAZOL-1-YL)-ETHANOL Preparation Products And Raw materials |
|