|
|
| | 1-(1H-IMIDAZOL-2-YL)-ETHANONE HCL Basic information |
| Product Name: | 1-(1H-IMIDAZOL-2-YL)-ETHANONE HCL | | Synonyms: | 1-(1H-IMIDAZOL-2-YL)-ETHANONE HCL;Ethanone, 1-(1H-imidazol-2-yl)- (9CI);1-(1H-Imidazol-2-yl)-1-ethanone;2-ACETYLIMIDAZOLE;1-(1H-imidazol-2-yl)ethanone(SALTDATA: FREE);2-Acetylimidazole 97%;Ethanone, 1-(1H-imidazol-2-yl)-;1-(1H-imidazol-2-yl)ethan-1-one | | CAS: | 53981-69-4 | | MF: | C5H6N2O | | MW: | 110.11 | | EINECS: | | | Product Categories: | ACETYLGROUP | | Mol File: | 53981-69-4.mol |  |
| | 1-(1H-IMIDAZOL-2-YL)-ETHANONE HCL Chemical Properties |
| Melting point | 136-138℃ | | Boiling point | 269.4±23.0 °C(Predicted) | | density | 1.190±0.06 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Room Temperature | | pka | 11.11±0.10(Predicted) | | Appearance | Off-white to light yellow Solid | | InChI | InChI=1S/C5H6N2O/c1-4(8)5-6-2-3-7-5/h2-3H,1H3,(H,6,7) | | InChIKey | OSMJIXXVEWORDJ-UHFFFAOYSA-N | | SMILES | C(=O)(C1NC=CN=1)C |
| Risk Statements | 36 | | Safety Statements | 26 | | HS Code | 2933992000 |
| | 1-(1H-IMIDAZOL-2-YL)-ETHANONE HCL Usage And Synthesis |
| Uses | 1-(1H-Imidazol-2-yl)ethanone is a useful research chemical compound used in the synthetic preparation of imidazoles. |
| | 1-(1H-IMIDAZOL-2-YL)-ETHANONE HCL Preparation Products And Raw materials |
|