6-O-Des(6-Amino-α-D-gluocopyranosyl) Amikacin manufacturers
- Amikacin Impurity L
-
-
2026-03-12
- CAS:1793053-92-5
- Min. Order: 10mg
- Purity: 0.98
- Supply Ability: 10g
- Amikacin Impurity
-
-
2025-12-16
- CAS:1793053-92-5
- Min. Order: 10mg
- Purity: 98
- Supply Ability: 1000000000000
|
| | 6-O-Des(6-Amino-α-D-gluocopyranosyl) Amikacin Basic information |
| Product Name: | 6-O-Des(6-Amino-α-D-gluocopyranosyl) Amikacin | | Synonyms: | Amikacin Impurity 10;Amikacin Impurity 16;Amikacin Impurity L;D-Streptamine, 6-O-(3-amino-3-deoxy-α-D-glucopyranosyl)-N1-[(2S)-4-amino-2-hydroxy-1-oxobutyl]-2-deoxy-;Amikacin Impurity K;Amikacin Impurity J;6-O-Des(6-Amino-α-D-gluocopyranosyl) Amikacin;Pirtobrutinib Impurity 2 | | CAS: | 1793053-92-5 | | MF: | C16H32N4O9 | | MW: | 424.45 | | EINECS: | | | Product Categories: | | | Mol File: | 1793053-92-5.mol |  |
| | 6-O-Des(6-Amino-α-D-gluocopyranosyl) Amikacin Chemical Properties |
| Boiling point | 819.2±65.0 °C(Predicted) | | density | 1.55±0.1 g/cm3(Predicted) | | solubility | Water (Slightly) | | form | Solid | | pka | 13.07±0.70(Predicted) | | color | White to Off-White | | InChIKey | HMOKJJPLZODRRD-WBVXSSHCNA-N | | SMILES | O([C@]1([H])[C@@H]([C@@H](N)[C@H](O)[C@@H](CO)O1)O)[C@@H]1[C@H]([C@H](O)[C@@H](N)C[C@H]1NC(=O)[C@@H](O)CCN)O |&1:1,3,4,6,8,13,14,15,17,20,24,r| |
| | 6-O-Des(6-Amino-α-D-gluocopyranosyl) Amikacin Usage And Synthesis |
| Uses | 6-O-Des(6-Amino-a-D-gluocopyranosyl) Amikacin Sulfate is a derivative of Amikacin (A578500), semisynthetic aminoglycoside antibiotic derived from Kanamycin A. Antibacterial. |
| | 6-O-Des(6-Amino-α-D-gluocopyranosyl) Amikacin Preparation Products And Raw materials |
|