|
|
| | (1S,2S)-2-Amino-1-(4-nitrophenyl)propane-1,3-diol Basic information |
| | (1S,2S)-2-Amino-1-(4-nitrophenyl)propane-1,3-diol Chemical Properties |
| Melting point | 163-166 °C(lit.) | | alpha | 31 º (C=1 IN 6 M HCL) | | Boiling point | 352.03°C (rough estimate) | | density | 1.3136 (rough estimate) | | refractive index | 1.5373 (estimate) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | solubility | soluble in DMSO, Methanol | | pka | 10.98±0.45(Predicted) | | form | Crystalline Powder | | color | Yellow to beige | | Optical Rotation | [α]23/D +31°, c = 1 in 6 M HCl | | InChI | InChI=1S/C9H12N2O4/c10-8(5-12)9(13)6-1-3-7(4-2-6)11(14)15/h1-4,8-9,12-13H,5,10H2/t8-,9-/m0/s1 | | InChIKey | OCYJXSUPZMNXEN-IUCAKERBSA-N | | SMILES | [C@@H](C1=CC=C([N+]([O-])=O)C=C1)(O)[C@@H](N)CO |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29221990 | | Storage Class | 11 - Combustible Solids |
| | (1S,2S)-2-Amino-1-(4-nitrophenyl)propane-1,3-diol Usage And Synthesis |
| Chemical Properties | yellow to beige crystalline powder | | Uses | (1S,2S)-2-Amino-1-(4-nitrophenyl)propane-1,3-diol can be used in the synthesis of (4S,5S)-(-)-isocytoxazone. |
| | (1S,2S)-2-Amino-1-(4-nitrophenyl)propane-1,3-diol Preparation Products And Raw materials |
|