|
|
| | Coconut oil monoethanolamide Basic information |
| Product Name: | Coconut oil monoethanolamide | | Synonyms: | N-(Hydroxyethyl)amide coconut;coconut oil monoethanolamide;Amides, coco, N-(hydroxyethyl);COCAMIDE MEA;Coconut acid monoethanolamide (Detergent 6501;Coco fatty acid monoethanolamide;Amide, Kokos-, N-(Hydroxyethyl);N-hydroxyethyl cocamide | | CAS: | 68140-00-1 | | MF: | C14H29NO2 | | MW: | 0 | | EINECS: | 268-770-2 | | Product Categories: | Hair Care;Home Care;Skin Care | | Mol File: | Mol File | ![Coconut oil monoethanolamide Structure]() |
| | Coconut oil monoethanolamide Chemical Properties |
| Melting point | 65 - 67oC | | density | 1.08-1.09 g/cm3 | | refractive index | 1.515 | | storage temp. | -20°C Freezer, Under inert atmosphere | | solubility | Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly) | | form | Solid | | color | White to Off-White | | Odor | Bland | | InChI | InChI=1S/C14H29NO2/c1-2-3-4-5-6-7-8-9-10-11-14(17)15-12-13-16/h16H,2-13H2,1H3,(H,15,17) | | InChIKey | QZXSMBBFBXPQHI-UHFFFAOYSA-N | | SMILES | C(NCCO)(=O)CCCCCCCCCCC | | NIST Chemistry Reference | N-(2-hydroxyethyl)dodecanamide(68140-00-1) | | EPA Substance Registry System | Coco ethanolamides (68140-00-1) |
| | Coconut oil monoethanolamide Usage And Synthesis |
| Uses | Coconut Oil Monoethanolamide can be used for cosmetic cleansing compositions that are free of sodium chloride and sulfate-based surfactants. | | Definition | ChEBI: N-(dodecanoyl)ethanolamine is an N-(long-chain-acyl)ethanolamine resulting from the formal condensation of the carboxy group of dodecanoic acid (myristic acid) with the amino group of ethanolamine. It is a N-(long-chain-acyl)ethanolamine and a N-(saturated fatty acyl)ethanolamine. It is functionally related to a dodecanoic acid. |
| | Coconut oil monoethanolamide Preparation Products And Raw materials |
|