| Company Name: |
Pushan Industry (Shaanxi) Co., Ltd
|
| Tel: |
029-81310890 18165209495 |
| Email: |
2929288192@qq.com |
| Products Intro: |
Product Name:2',5'-Dihydroxy-4-methoxychalcone CAS:6342-92-3 Purity:99% Package:25kg
|
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Email: |
ordercn@merckgroup.com |
| Products Intro: |
Product Name:2′,5′-Dihydroxy-4-methoxychalcone CAS:6342-92-3
|
|
| | 2-Propen-1-one, 1-(2,5-dihydroxyphenyl)-3-(4-methoxyphenyl)- Basic information |
| | 2-Propen-1-one, 1-(2,5-dihydroxyphenyl)-3-(4-methoxyphenyl)- Chemical Properties |
| Melting point | 178-180 °C | | Boiling point | 528.2±50.0 °C(Predicted) | | density | 1.282±0.06 g/cm3(Predicted) | | pka | 8.29±0.43(Predicted) | | form | solid | | InChI | 1S/C16H14O4/c1-20-13-6-2-11(3-7-13)4-8-15(18)14-10-12(17)5-9-16(14)19/h2-10,17,19H,1H3/b8-4+ | | InChIKey | FUQGIYDZGLORRC-XBXARRHUSA-N | | SMILES | COc1ccc(\C=C\C(=O)c2cc(O)ccc2O)cc1 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | 2-Propen-1-one, 1-(2,5-dihydroxyphenyl)-3-(4-methoxyphenyl)- Usage And Synthesis |
| | 2-Propen-1-one, 1-(2,5-dihydroxyphenyl)-3-(4-methoxyphenyl)- Preparation Products And Raw materials |
|