Acetamide, 2-chloro-N-[4-(4-methoxyphenoxy)phenyl]-N-(phenylmethyl)- manufacturers
- CCW16
-
- $30.00
-
2026-04-20
- CAS:2361138-33-0
- Purity: 97.00%
- Supply Ability: 10g
|
| | Acetamide, 2-chloro-N-[4-(4-methoxyphenoxy)phenyl]-N-(phenylmethyl)- Basic information |
| | Acetamide, 2-chloro-N-[4-(4-methoxyphenoxy)phenyl]-N-(phenylmethyl)- Chemical Properties |
| Boiling point | 533.2±50.0 °C(Predicted) | | density | 1.240±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 0.86±0.50(Predicted) | | form | Solid | | color | Light yellow to yellow | | InChI | 1S/C22H20ClNO3/c1-26-19-11-13-21(14-12-19)27-20-9-7-18(8-10-20)24(22(25)15-23)16-17-5-3-2-4-6-17/h2-14H,15-16H2,1H3 | | InChIKey | DPADEQNOMBTITM-UHFFFAOYSA-N | | SMILES | COC1=CC=C(OC2=CC=C(N(CC3=CC=CC=C3)C(CCl)=O)C=C2)C=C1 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 |
| | Acetamide, 2-chloro-N-[4-(4-methoxyphenoxy)phenyl]-N-(phenylmethyl)- Usage And Synthesis |
| Uses | CCW16 is a cofactor for the synthesis of protein degraders, such as PROTACs CCW 28-3 (HY-156774). | | reaction suitability | reagent type: ligand | | IC 50 | RNF4 | | References | [1] Ward CC, et, al. Covalent Ligand Screening Uncovers a RNF4 E3 Ligase Recruiter for Targeted Protein Degradation Applications. ACS Chem Biol. 2019 Nov 15;14(11):2430-2440. DOI:10.1021/acschembio.8b01083 |
| | Acetamide, 2-chloro-N-[4-(4-methoxyphenoxy)phenyl]-N-(phenylmethyl)- Preparation Products And Raw materials |
|