|
|
| | Trihydroxymethylpropyl trioleate Basic information |
| Product Name: | Trihydroxymethylpropyl trioleate | | Synonyms: | Trihydroxymethylpropyl trioleate;Decanoic acid, ester with 2-ethyl-2-(hydroxymethyl)-1,3-propanediol octanoate;trihydroxymethylpropyl ester with decanoic acid and octanoic;TRIMETHYLOLPROPANE TRICAPRYLATE/TRICAPRATE;Trimethylolpropane caprate-caprylate;trimethylolpropane, caprylate caprate triester;Trihydroxymethylpropyl ester with decanoic acid and octanoic acid;Trimethylolpropane caprylate/caprate | | CAS: | 11138-60-6 | | MF: | C24H50O7 | | MW: | 450.66 | | EINECS: | 234-392-1 | | Product Categories: | | | Mol File: | 11138-60-6.mol |  |
| | Trihydroxymethylpropyl trioleate Chemical Properties |
| storage temp. | Cool Dry Place | | form | liquid | | Cosmetics Ingredients Functions | SKIN CONDITIONING
SKIN CONDITIONING - EMOLLIENT | | InChI | InChI=1S/C10H20O2.C8H16O2.C6H14O3/c1-2-3-4-5-6-7-8-9-10(11)12;1-2-3-4-5-6-7-8(9)10;1-2-6(3-7,4-8)5-9/h2-9H2,1H3,(H,11,12);2-7H2,1H3,(H,9,10);7-9H,2-5H2,1H3 | | InChIKey | ZDIYIODMIWSRET-UHFFFAOYSA-N | | SMILES | C(CO)(CO)(CO)CC.C(CC(=O)O)CCCCC.C(CCC(=O)O)CCCCCC | | LogP | 3.965 (est) | | EPA Substance Registry System | Trimethylolpropane octanoate decanoate (11138-60-6) |
| | Trihydroxymethylpropyl trioleate Usage And Synthesis |
| Uses | Trihydroxymethylpropyl trioleate can be used as lubricants, metal oil additives, chemical fibre oils, plastic lubricants and so on. |
| | Trihydroxymethylpropyl trioleate Preparation Products And Raw materials |
|