|
|
| | 2,5-Dimethyl-2,5-di(2-ethylhexanoylperoxy)hexane Basic information |
| Product Name: | 2,5-Dimethyl-2,5-di(2-ethylhexanoylperoxy)hexane | | Synonyms: | 2,5-Dimethylhexane-2,5-diperoctoate;2,5-Di-(2-ethylhexanoyl-peroxy)-2,5-dimethylhexan21;2,5-bis(2-Ethylhexanoylperoxy)-2,5-dimethylhexane;2,5-Dimethyl-2,5-di(2-ethylhexanoylperoxy)hexane;1,1,4,4-tetramethylbutane-1,4-diyl bis(2-ethylperoxyhexanoate);2,5-Dimethyl-2,5-bis(2-ethylhexanoyl peroxy)hexane;Hexaneperoxoic acid, 2-ethyl-, 1,1,4,4-tetramethyl-1,4-butanediyl ester;hexaneperoxoic acid, 2-ethyl-,1,1,4,4-tetramethyl-1,4-butanediyl ester | | CAS: | 13052-09-0 | | MF: | C24H46O6 | | MW: | 430.62 | | EINECS: | 235-935-5 | | Product Categories: | | | Mol File: | 13052-09-0.mol |  |
| | 2,5-Dimethyl-2,5-di(2-ethylhexanoylperoxy)hexane Chemical Properties |
| Boiling point | 471.1±55.0 °C(Predicted) | | density | 0.967±0.06 g/cm3(Predicted) | | vapor pressure | 0.01Pa at 25℃ | | Water Solubility | 27.9μg/L at 20℃ | | InChI | InChI=1S/C24H46O6/c1-9-13-15-19(11-3)21(25)27-29-23(5,6)17-18-24(7,8)30-28-22(26)20(12-4)16-14-10-2/h19-20H,9-18H2,1-8H3 | | InChIKey | JUIBLDFFVYKUAC-UHFFFAOYSA-N | | SMILES | CC(C)(OOC(=O)C(CC)CCCC)CCC(C)(OOC(=O)C(CC)CCCC)C | | LogP | 7.1 at 25℃ | | EPA Substance Registry System | Hexaneperoxoic acid, 2-ethyl-, OO1,OO1'-(1,1,4,4-tetramethyl-1,4-butanediyl) ester (13052-09-0) |
| RIDADR | 3115 | | TSCA | TSCA listed | | HazardClass | 5.2 | | PackingGroup | II |
| | 2,5-Dimethyl-2,5-di(2-ethylhexanoylperoxy)hexane Usage And Synthesis |
| Chemical Properties | Colorless liquid, slight mint odor. |
| | 2,5-Dimethyl-2,5-di(2-ethylhexanoylperoxy)hexane Preparation Products And Raw materials |
|