- Mirabegron Impurity 32
-
- $0.00 / 10mg
-
2026-01-23
- CAS:32897-26-0
- Min. Order: 10mg
- Purity: 95%+
- Supply Ability: 5g
|
| | 1-Ethyl-3(3-dimethylamino)urea Basic information |
| Product Name: | 1-Ethyl-3(3-dimethylamino)urea | | Synonyms: | 1-ETHYL-1-3-(3-DIMETHYLAMINOPROPYL)UREA;1-[3-(DiMethylaMino)propyl]-3-ethylurea;1-Ethyl-3-(3-dimethylaminopropyl)urea;1-Ethyl-3-(3-diMethylaMinopropyl)urea hydrochloride;synthesis-004;Avanafil Impurity 65;1-[3-(Dimethylamino)propyl]-3-ethylurea,97%;Urea, N-[3-(dimethylamino)propyl]-N'-ethyl- | | CAS: | 32897-26-0 | | MF: | C8H19N3O | | MW: | 173.26 | | EINECS: | 628-471-3 | | Product Categories: | | | Mol File: | 32897-26-0.mol |  |
| | 1-Ethyl-3(3-dimethylamino)urea Chemical Properties |
| Boiling point | 316.5±25.0 °C(Predicted) | | density | 0.948±0.06 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Room Temperature | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Oil | | pka | 14.67±0.46(Predicted) | | color | Colourless to Light Yellow | | Water Solubility | Soluble in water. | | Stability: | Moisture Sensitive | | InChI | InChI=1S/C8H19N3O/c1-4-9-8(12)10-6-5-7-11(2)3/h4-7H2,1-3H3,(H2,9,10,12) | | InChIKey | NGJUYARYEXGDNN-UHFFFAOYSA-N | | SMILES | N(CCCN(C)C)C(NCC)=O |
| | 1-Ethyl-3(3-dimethylamino)urea Usage And Synthesis |
| Uses | 1-[3-(Dimethylamino)propyl]-3-ethylurea is used in the preparation of cabergoline, which is a dopamine receptor used to treat Parkinsons syndrom. |
| | 1-Ethyl-3(3-dimethylamino)urea Preparation Products And Raw materials |
|