|
|
| | Bisphenol-A bis(diphenyl phosphate) Basic information |
| Product Name: | Bisphenol-A bis(diphenyl phosphate) | | Synonyms: | Phosphoric acid,P,P'-[(1-Methylethylidene)di-4,1-phenylene] P,P,P',P'-tetraphenyl ester;Phosphoric Acid Isopropylidenedi-p-phenylene Tetraphenyl Ester;BISPHENYL A BIS (DIPHENYL PHOSPHATE) BDP;Phosphoric acid, (1-methylethylidene)di-4,1-phenylene tetraphenyl ester;Bisphenol-A-di(diphenylphosphat);Bisphenol-A Bis(Diphenyl Phosphate);OLIGOMERICBISPHENYLABIS(DIPHENYLPHOSPHATE);2,2-Bis[4-[bis(phenoxy)phos | | CAS: | 5945-33-5 | | MF: | C39H34O8P2 | | MW: | 692.64 | | EINECS: | 425-220-8 | | Product Categories: | Aromatics;Intermediates & Fine Chemicals;Pharmaceuticals | | Mol File: | 5945-33-5.mol |  |
| | Bisphenol-A bis(diphenyl phosphate) Chemical Properties |
| Boiling point | 679.6±48.0 °C(Predicted) | | density | 1.283±0.06 g/cm3(Predicted) | | vapor pressure | 0-0.001Pa at 25℃ | | storage temp. | Refrigerator | | solubility | DMSO (Slightly), Ethyl Acetate (Slightly), Methanol (Slightly) | | form | Oil | | color | Colourless to Off-White | | Water Solubility | 415μg/L at 20℃ | | InChIKey | BQPNUOYXSVUVMY-UHFFFAOYSA-N | | SMILES | P(=O)(OC1C=CC=CC=1)(OC1C=CC=CC=1)OC1C=CC(C(C2C=CC(OP(=O)(OC3C=CC=CC=3)OC3C=CC=CC=3)=CC=2)(C)C)=CC=1 | | LogP | 6 at 20℃ | | EPA Substance Registry System | Phosphoric acid, (1-methylethylidene)di-4,1-phenylene tetraphenyl ester (5945-33-5) |
| | Bisphenol-A bis(diphenyl phosphate) Usage And Synthesis |
| Chemical Properties | Colourless Thick Oil | | Uses | Bisphenol A Bis(diphenyl phosphate) is a flame retardant. Bisphenol A Bis(diphenyl phosphate) is used in electrical wire covering and other flame resistant materials. | | Flammability and Explosibility | Non flammable |
| | Bisphenol-A bis(diphenyl phosphate) Preparation Products And Raw materials |
|