|
|
| | (1,5-dimethylhexyl)ammonium chloride Basic information |
| Product Name: | (1,5-dimethylhexyl)ammonium chloride | | Synonyms: | 2-Heptanamine,6-methyl-, hydrochloride;2-Heptanamine,6-methyl-, hydrochloride (1:1);(1,5-dimethylhexyl)ammonium chloride;2-Aminoisopheptane;YISA-Biotech 1,5 DMHA Powder ,Octodrine1,5-DimethylHexylamine;Octodrine (hydrochloride);Vaporpac hydrochloride, 2-Isooctylamine hydrochloride;6-Methylheptan-2-amine hydrochloride | | CAS: | 5984-59-8 | | MF: | C8H20ClN | | MW: | 165.7041 | | EINECS: | 227-798-5 | | Product Categories: | | | Mol File: | 5984-59-8.mol |  |
| | (1,5-dimethylhexyl)ammonium chloride Chemical Properties |
| Melting point | 139-140 °C | | solubility | DMF: 50 mg/ml; DMSO: 50 mg/ml; Ethanol: 20 mg/ml; PBS (pH 7.2): 10 mg/ml | | form | A crystalline solid | | color | White to off-white | | Stability: | Hygroscopic | | InChI | InChI=1S/C8H19N.ClH/c1-7(2)5-4-6-8(3)9;/h7-8H,4-6,9H2,1-3H3;1H | | InChIKey | JWQWFYMPBWLERY-UHFFFAOYSA-N | | SMILES | [NH3+]C(C)CCCC(C)C.[Cl-] |
| | (1,5-dimethylhexyl)ammonium chloride Usage And Synthesis |
| Description | Octodrine (hydrochloride) (Item No. 21927) is an analytical reference standard categorized as a stimulant. This product is intended for research and forensic applications. | | Uses | 1,5-Dimethylhexylamine Hydrochloride is an aliphatic secondary amine which shows leucine aminotransferase inhibition. 1,5-Dimethylhexylamine Hydrochloride is used in the preparation of glycosyl β-amino acids with antitubercular activity. | | References | [1] A. AL-IMAM B A A. Captagon, Octodrine, and NBOMe: An Integrative Analysis of Trends Databases, the Deep Web, and the Darknet[J]. Global Journal of Health Science, 2017, 1 1: 114. DOI: 10.5539/gjhs.v9n11p114 |
| | (1,5-dimethylhexyl)ammonium chloride Preparation Products And Raw materials |
|