| Company Name: |
Energy Chemical Gold |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
2-Thiophenecarboxaldehyde, 5-[4-[bis(4-methoxyphenyl)amino]phenyl]- manufacturers
|
| | 2-Thiophenecarboxaldehyde, 5-[4-[bis(4-methoxyphenyl)amino]phenyl]- Basic information |
| | 2-Thiophenecarboxaldehyde, 5-[4-[bis(4-methoxyphenyl)amino]phenyl]- Chemical Properties |
| Boiling point | 608.6±55.0 °C(Predicted) | | density | 1.240±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C, protect from light, stored under nitrogen | | pka | -1.97±0.60(Predicted) | | Appearance | Yellow to orange Solid | | InChI | InChI=1S/C25H21NO3S/c1-28-22-11-7-20(8-12-22)26(21-9-13-23(29-2)14-10-21)19-5-3-18(4-6-19)25-16-15-24(17-27)30-25/h3-17H,1-2H3 | | InChIKey | DNRVOYFKFSVBHG-UHFFFAOYSA-N | | SMILES | C1(C=O)SC(C2=CC=C(N(C3=CC=C(OC)C=C3)C3=CC=C(OC)C=C3)C=C2)=CC=1 |
| | 2-Thiophenecarboxaldehyde, 5-[4-[bis(4-methoxyphenyl)amino]phenyl]- Usage And Synthesis |
| | 2-Thiophenecarboxaldehyde, 5-[4-[bis(4-methoxyphenyl)amino]phenyl]- Preparation Products And Raw materials |
|