methyl 2,2,3,3-tetrafluoro-3-methoxypropionate manufacturers
|
| methyl 2,2,3,3-tetrafluoro-3-methoxypropionate Basic information | Appearance |
Product Name: | methyl 2,2,3,3-tetrafluoro-3-methoxypropionate | Synonyms: | 3-methoxyperfluoropropionate;2,2,3,3-Tetrafluoro-3-methoxypropanoic acid methyl ester;2,2,3,3-Tetrafluoro-3-methoxypropionic acid methyl ester;3-Methoxyperfluoropropionic acid methyl ester;methyl 2,2,3,3-tetrafluoro-3-methoxypropanoate;methyl 2,2,3,3-tetrafluoro-3-methoxy-propanoate;Methyl3-methoxytetrafluoropropanoate;Methyl 3-methoxytetrafluoropropionate | CAS: | 755-73-7 | MF: | C5H6F4O3 | MW: | 190.09 | EINECS: | 212-048-1 | Product Categories: | | Mol File: | 755-73-7.mol |  |
| methyl 2,2,3,3-tetrafluoro-3-methoxypropionate Chemical Properties |
Boiling point | 159℃ | density | 1.331 | refractive index | 1.3327 | Fp | 48℃ | form | liquid | color | Clear | InChI | InChI=1S/C5H6F4O3/c1-11-3(10)4(6,7)5(8,9)12-2/h1-2H3 | InChIKey | NDNOUXQCMAHOSA-UHFFFAOYSA-N | SMILES | C(OC)(=O)C(F)(F)C(F)(F)OC | EPA Substance Registry System | Methyl 2,2,3,3-tetrafluoro-3-methoxypropionate (755-73-7) |
| methyl 2,2,3,3-tetrafluoro-3-methoxypropionate Usage And Synthesis |
Appearance | Liquid | Uses | Methyl 2,2,3,3-tetrafluoro-3-methoxypropionate is a useful research chemical. | Uses | Methyl 2,2,3,3-tetrafluoro-3-methoxypropionate belongs to carboxylate organic compounds and can be used as an intermediate in organic synthesis. |
| methyl 2,2,3,3-tetrafluoro-3-methoxypropionate Preparation Products And Raw materials |
|