methyl 2,2,3,3-tetrafluoro-3-methoxypropionate manufacturers
|
| | methyl 2,2,3,3-tetrafluoro-3-methoxypropionate Basic information | | Appearance |
| Product Name: | methyl 2,2,3,3-tetrafluoro-3-methoxypropionate | | Synonyms: | 3-methoxyperfluoropropionate;2,2,3,3-Tetrafluoro-3-methoxypropanoic acid methyl ester;2,2,3,3-Tetrafluoro-3-methoxypropionic acid methyl ester;3-Methoxyperfluoropropionic acid methyl ester;methyl 2,2,3,3-tetrafluoro-3-methoxypropanoate;methyl 2,2,3,3-tetrafluoro-3-methoxy-propanoate;Methyl3-methoxytetrafluoropropanoate;Methyl 3-methoxytetrafluoropropionate | | CAS: | 755-73-7 | | MF: | C5H6F4O3 | | MW: | 190.09 | | EINECS: | 212-048-1 | | Product Categories: | | | Mol File: | 755-73-7.mol |  |
| | methyl 2,2,3,3-tetrafluoro-3-methoxypropionate Chemical Properties |
| Boiling point | 159℃ | | density | 1.331 | | refractive index | 1.3327 | | Fp | 48℃ | | form | liquid | | color | Clear | | InChI | InChI=1S/C5H6F4O3/c1-11-3(10)4(6,7)5(8,9)12-2/h1-2H3 | | InChIKey | NDNOUXQCMAHOSA-UHFFFAOYSA-N | | SMILES | C(OC)(=O)C(F)(F)C(F)(F)OC | | EPA Substance Registry System | Methyl 2,2,3,3-tetrafluoro-3-methoxypropionate (755-73-7) |
| TSCA | TSCA listed | | HS Code | 2918999090 |
| | methyl 2,2,3,3-tetrafluoro-3-methoxypropionate Usage And Synthesis |
| Appearance | Liquid | | Uses | Methyl 2,2,3,3-tetrafluoro-3-methoxypropionate is a useful research chemical. | | Uses | Methyl 2,2,3,3-tetrafluoro-3-methoxypropionate belongs to carboxylate organic compounds and can be used as an intermediate in organic synthesis. |
| | methyl 2,2,3,3-tetrafluoro-3-methoxypropionate Preparation Products And Raw materials |
|