| Company Name: |
Shenzhen SUNGENING Bio-Medical Co., Ltd. Gold
|
| Tel: |
0755-28967200 13631290199 |
| Email: |
wxf@sungening.com |
| Products Intro: |
Product Name:Posaconazole Impurity 103
CAS:1978305-26-8
Package:10mg/;25mg/;50mg/;100mg/
|
| Company Name: |
Quality Control Solutions Ltd.
|
| Tel: |
0755-66853366 13670046396 |
| Email: |
orders@qcsrm.com |
| Products Intro: |
Product Name:Posaconazole Impurity 164
CAS:1978305-26-8
Purity:95% HPLC Package:10mg;25mg;50mg;100mg
|
| Company Name: |
Jinan blalong chemical co. LTD
|
| Tel: |
2710913286@.com |
| Email: |
1513643261@qq.com |
| Products Intro: |
Product Name:PosacozoleImpurity85
CAS:1978305-26-8
Purity:99% HPLC Package:50G;10G;1G;500MG;100MG
|
| Company Name: |
Huaihua Yuanyanda Biotechnology Co., Ltd
|
| Tel: |
18711085600 |
| Email: |
1652923704@qq.com |
| Products Intro: |
Product Name:Posaconazole Impurity 11
CAS:1978305-26-8
Purity:98% HPLC Package:10mg;25mg;50mg;100mg
|
| Company Name: |
HX Pharmaceutical technology co., LTD
|
| Tel: |
15671363360 |
| Email: |
494267389@qq.com |
| Products Intro: |
Product Name:Posaconazole Impurity 85
CAS:1978305-26-8
Purity:>95%? HPLC Package:10mg；20mg；50mg；100mg
|
|
| | D-threo-Pentitol, 2,5-anhydro-1,3,4-trideoxy-2-C-(4-fluorophenyl)-4-(hydroxymethyl)-1-(1H-1,2,4-triazol-1-yl)- Basic information |
| Product Name: | D-threo-Pentitol, 2,5-anhydro-1,3,4-trideoxy-2-C-(4-fluorophenyl)-4-(hydroxymethyl)-1-(1H-1,2,4-triazol-1-yl)- | | Synonyms: | D-threo-Pentitol, 2,5-anhydro-1,3,4-trideoxy-2-C-(4-fluorophenyl)-4-(hydroxymethyl)-1-(1H-1,2,4-triazol-1-yl)-;Posaconazole Impurity 164;PosacozoleImpurity85 | | CAS: | 1978305-26-8 | | MF: | C14H16FN3O2 | | MW: | 277.29 | | EINECS: | | | Product Categories: | | | Mol File: | 1978305-26-8.mol |  |
| | D-threo-Pentitol, 2,5-anhydro-1,3,4-trideoxy-2-C-(4-fluorophenyl)-4-(hydroxymethyl)-1-(1H-1,2,4-triazol-1-yl)- Chemical Properties |
| Boiling point | 462.8±55.0 °C(Predicted) | | density | 1.35±0.1 g/cm3(Predicted) | | pka | 14.81±0.10(Predicted) | | InChI | InChI=1/C14H16FN3O2/c15-13-3-1-12(2-4-13)14(5-11(6-19)7-20-14)8-18-10-16-9-17-18/h1-4,9-11,19H,5-8H2/t11-,14+/s3 | | InChIKey | SSXYWVPZKZMMLF-LNBRXUOKNA-N | | SMILES | N1=CN(C[C@@]2(C3=CC=C(F)C=C3)OC[C@@H](CO)C2)N=C1 |&1:4,14,r| |
| | D-threo-Pentitol, 2,5-anhydro-1,3,4-trideoxy-2-C-(4-fluorophenyl)-4-(hydroxymethyl)-1-(1H-1,2,4-triazol-1-yl)- Usage And Synthesis |
| | D-threo-Pentitol, 2,5-anhydro-1,3,4-trideoxy-2-C-(4-fluorophenyl)-4-(hydroxymethyl)-1-(1H-1,2,4-triazol-1-yl)- Preparation Products And Raw materials |
|