| | desomorphine Basic information |
| | desomorphine Chemical Properties |
| Melting point | 189° | | alpha | D28 -77° (c = 1.6 in methanol) | | Boiling point | 414.44°C (rough estimate) | | density | 1.0288 (rough estimate) | | refractive index | 1.5022 (estimate) | | Fp | 2℃ | | storage temp. | -20°C | | solubility | DMF: 50 mg/ml; DMSO: 50 mg/ml; Ethanol: 50 mg/ml; PBS (pH 7.2): 0.15 mg/ml | | pka | 9.67±0.20(Predicted) | | form | A crystalline solid | | InChI | 1S/C17H21NO2/c1-18-8-7-17-11-3-2-4-14(17)20-16-13(19)6-5-10(15(16)17)9-12(11)18/h5-6,11-12,14,19H,2-4,7-9H2,1H3/t11-,12+,14-,17+/m0/s1 | | InChIKey | LNNWVNGFPYWNQE-GMIGKAJZSA-N | | SMILES | OC1=C(O2)C([C@@]3([C@]2([H])CCC4)[C@]4([H])[C@H](N(C)CC3)C5)=C5C=C1 |
| Hazard Codes | F,Xn | | Risk Statements | 11-20/21/22-36 | | Safety Statements | 16-36/37 | | RIDADR | UN 1648 3 / PGII | | WGK Germany | 2 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Acute Tox. 4 Dermal
Acute Tox. 4 Inhalation
Acute Tox. 4 Oral
Eye Irrit. 2
Flam. Liq. 2 | | Hazardous Substances Data | 427-00-9(Hazardous Substances Data) | | DEA Controlled Substances | CSCN: 9055
CSA SCH: Schedule I
NARC: Yes |
| | desomorphine Usage And Synthesis |
| Chemical Properties | Off-White to Light Beige Solid | | Uses | Desomorphine, is an Analgesic (narcotic).
Controlled substance (opium derivative). | | Definition | ChEBI: Desomorphine is a morphinane alkaloid. | | General Description | Desomorphine, most commonly referred to by its street name Krokodil, is a designer opiate and morphine derivative originally abused in Russia and other parts of Europe due to its ease of manufacture from codeine. Desomophine was previously sold under the trade name Permonid as an opiate drug for treatment of pain. This certified solution standard is suitable for use in LC/MS or GC/MS opiate testing applications in clinical toxicology, forensic analysis, prescription monitoring, or urine drug testing. |
| | desomorphine Preparation Products And Raw materials |
|