|
|
| | benzoic acid, compound with 2-aminoethanol (1:1) Basic information |
| Product Name: | benzoic acid, compound with 2-aminoethanol (1:1) | | Synonyms: | benzoate of monoethanolamine;2-Aminoethanol benzoate;MonoethaneaMine benzoate;2-Aminoethanol benzoate (salt);benzoic acid, compound with 2-aminoethanol (1:1);Ethanol, 2-amino-, benzoate (salt);2-hydroxyethylazanium,benzoate;Ethanol, 2-amino-, benzoate (1:1) | | CAS: | 4337-66-0 | | MF: | C9H13NO3 | | MW: | 183.20442 | | EINECS: | 224-387-2 | | Product Categories: | | | Mol File: | 4337-66-0.mol |  |
| | benzoic acid, compound with 2-aminoethanol (1:1) Chemical Properties |
| Melting point | 142-144℃ (ethanol ) | | Cosmetics Ingredients Functions | PRESERVATIVE | | InChI | InChI=1S/C7H6O2.C2H7NO/c8-7(9)6-4-2-1-3-5-6;3-1-2-4/h1-5H,(H,8,9);4H,1-3H2 | | InChIKey | WUGCLPOLOCIDHW-UHFFFAOYSA-N | | SMILES | [NH3+]CCO.C([O-])(=O)C1=CC=CC=C1 | | EPA Substance Registry System | Ethanol, 2-amino-, benzoate (salt) (4337-66-0) |
| | benzoic acid, compound with 2-aminoethanol (1:1) Usage And Synthesis |
| Description | MEA-Benzoate is the salt of monoethanolamine and Benzoic Acid. |
| | benzoic acid, compound with 2-aminoethanol (1:1) Preparation Products And Raw materials |
|