|
|
| | propylene di(octanoate) Basic information |
| Product Name: | propylene di(octanoate) | | Synonyms: | PropylenglycolDioctanoate;Octanoic acid, 1-methyl-1,2-ethanediyl ester;1,2-dicaprylin;PGDICAPRYLATE;1,2-Propylene glycol dicaprylate;1,2-Propylene glycol dioctanoate;Bisoctanoic acid 1,2-propanediyl ester;Dioctanoic acid 1,2-propanediyl ester | | CAS: | 7384-98-7 | | MF: | C19H36O4 | | MW: | 328.49 | | EINECS: | 230-962-9 | | Product Categories: | | | Mol File: | 7384-98-7.mol |  |
| | propylene di(octanoate) Chemical Properties |
| Boiling point | 397.7±15.0 °C(Predicted) | | density | 0.939±0.06 g/cm3(Predicted) | | FEMA | 4471 | PROPYLENEGLYCOL DIOCTANOATE | | storage temp. | Sealed in dry,Room Temperature | | Odor | fatty fruity | | Odor Type | fruity | | JECFA Number | 1985 | | Cosmetics Ingredients Functions | VISCOSITY CONTROLLING
SKIN CONDITIONING - EMOLLIENT | | InChI | InChI=1S/C19H36O4/c1-4-6-8-10-12-14-18(20)22-16-17(3)23-19(21)15-13-11-9-7-5-2/h17H,4-16H2,1-3H3 | | InChIKey | OVYMWJFNQQOJBU-UHFFFAOYSA-N | | SMILES | C(OC(=O)CCCCCCC)(C)COC(=O)CCCCCCC | | LogP | 6.67 | | EPA Substance Registry System | Propylene glycol dioctanoate (7384-98-7) |
| | propylene di(octanoate) Usage And Synthesis |
| Uses | Propylene glycol dicaprylate is commonly used by the cosmetic industry in crams, lotions and topicals. |
| | propylene di(octanoate) Preparation Products And Raw materials |
|