| Company Name: |
TCI Europe |
| Tel: |
320-37350700 |
| Email: |
sales@tcieurope.eu |
| Company Name: |
TCI AMERICA |
| Tel: |
800-4238616 |
| Email: |
sales@tciamerica.com |
|
| | 4,5-Dihydroxymethyl-2-phenylimidazole Basic information |
| Product Name: | 4,5-Dihydroxymethyl-2-phenylimidazole | | Synonyms: | 4,5-Dihydroxymethyl-2-phenylimidazole;1H-Imidazole-4,5-dimethanol, 2-phenyl-;2-PHENYL-1H-IMIDAZOLE-4,5-DIMETHANOL;2-Phenyl-4,5-bis(hydroxymethyl)imidazole;Einecs 262-911-1;(2-Phenyl-1H-iMidazole-4,5-diyl)diMethanol;5-dimethanol, 2-phenyl-1H-Imidazole-4;4,5-Bis(hydroxymethyl)-2-phenylimidazole | | CAS: | 61698-32-6 | | MF: | C11H12N2O2 | | MW: | 204.23 | | EINECS: | 262-911-1 | | Product Categories: | | | Mol File: | 61698-32-6.mol |  |
| | 4,5-Dihydroxymethyl-2-phenylimidazole Chemical Properties |
| Melting point | 288 °C | | Boiling point | 516.9±40.0 °C(Predicted) | | density | 1.327±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 11.71±0.10(Predicted) | | form | powder to lump | | color | White to Light yellow | | Water Solubility | 194mg/L at 20℃ | | InChI | InChI=1S/C11H12N2O2/c14-6-9-10(7-15)13-11(12-9)8-4-2-1-3-5-8/h1-5,14-15H,6-7H2,(H,12,13) | | InChIKey | UUQQGGWZVKUCBD-UHFFFAOYSA-N | | SMILES | C1(C2=CC=CC=C2)NC(CO)=C(CO)N=1 | | LogP | 1.45 at 30℃ | | EPA Substance Registry System | 1H-Imidazole-4,5-dimethanol, 2-phenyl- (61698-32-6) |
| TSCA | TSCA listed | | HS Code | 2933.29.4300 |
| | 4,5-Dihydroxymethyl-2-phenylimidazole Usage And Synthesis |
| Flammability and Explosibility | Not classified |
| | 4,5-Dihydroxymethyl-2-phenylimidazole Preparation Products And Raw materials |
|