Benzoic acid, 4-[[(5-fluoro-2-methoxybenzoyl)amino]methyl]- manufacturers
|
| | Benzoic acid, 4-[[(5-fluoro-2-methoxybenzoyl)amino]methyl]- Basic information |
| | Benzoic acid, 4-[[(5-fluoro-2-methoxybenzoyl)amino]methyl]- Chemical Properties |
| Boiling point | 513.2±50.0 °C(Predicted) | | density | 1.311±0.06 g/cm3(Predicted) | | storage temp. | Store at room temperature | | pka | 4.18±0.10(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C16H14FNO4/c1-22-14-7-6-12(17)8-13(14)15(19)18-9-10-2-4-11(5-3-10)16(20)21/h2-8H,9H2,1H3,(H,18,19)(H,20,21) | | InChIKey | JKGIZYPXDZATPF-UHFFFAOYSA-N | | SMILES | C(O)(=O)C1=CC=C(CNC(=O)C2=CC(F)=CC=C2OC)C=C1 |
| | Benzoic acid, 4-[[(5-fluoro-2-methoxybenzoyl)amino]methyl]- Usage And Synthesis |
| | Benzoic acid, 4-[[(5-fluoro-2-methoxybenzoyl)amino]methyl]- Preparation Products And Raw materials |
|