2-methoxyethyl 2-cyanoacrylate manufacturers
|
| | 2-methoxyethyl 2-cyanoacrylate Basic information | | Uses |
| Product Name: | 2-methoxyethyl 2-cyanoacrylate | | Synonyms: | 2-methoxyethyl 2-cyanoacrylate;2-Propenoic acid, 2-cyano-, 2-methoxyethyl ester;2-CYANO-2-PROPENOICACID,2-METHOXYETHYLESTER;2-cyano-2-propenoic aci 2-methoxyethyl ester;2-Cyanoacrylic acid 2-methoxyethyl ester;methoxyethyl cyanoacrylate;2-Cyanopropenoic acid 2-methoxyethyl ester | | CAS: | 27816-23-5 | | MF: | C7H9NO3 | | MW: | 155.15 | | EINECS: | 248-670-5 | | Product Categories: | | | Mol File: | 27816-23-5.mol |  |
| | 2-methoxyethyl 2-cyanoacrylate Chemical Properties |
| Boiling point | 84-87 °C(Press: 2 Torr) | | density | 1.091±0.06 g/cm3(Predicted) | | vapor pressure | 44hPa at 20℃ | | Cosmetics Ingredients Functions | BINDING | | InChI | InChI=1S/C7H9NO3/c1-6(5-8)7(9)11-4-3-10-2/h1,3-4H2,2H3 | | InChIKey | JYTXVMYBYRTJTI-UHFFFAOYSA-N | | SMILES | C(OCCOC)(=O)C(C#N)=C | | EPA Substance Registry System | 2-Propenoic acid, 2-cyano-, 2-methoxyethyl ester (27816-23-5) |
| | 2-methoxyethyl 2-cyanoacrylate Usage And Synthesis |
| Uses | 2-Cyanoacrylate ethylene glycol monomethyl ether ester is an ester derivative that can be used as a pharmaceutical intermediate. |
| | 2-methoxyethyl 2-cyanoacrylate Preparation Products And Raw materials |
|