|
|
| | 3,5-Diisopropyl-4-hydroxybenzoic acid Basic information |
| | 3,5-Diisopropyl-4-hydroxybenzoic acid Chemical Properties |
| Melting point | 146 °C | | Boiling point | 343.5±42.0 °C(Predicted) | | density | 1.108±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | DMSO (Heated), Ethyl Acetate (Slightly), Methanol (Slightly) | | form | Solid | | pka | 4.65±0.10(Predicted) | | color | White to Off-White | | Major Application | pharmaceutical small molecule | | InChI | InChI=1S/C13H18O3/c1-7(2)10-5-9(13(15)16)6-11(8(3)4)12(10)14/h5-8,14H,1-4H3,(H,15,16) | | InChIKey | WYAZPCLFZZTVSP-UHFFFAOYSA-N | | SMILES | C(O)(=O)C1=CC(C(C)C)=C(O)C(C(C)C)=C1 |
| WGK Germany | WGK 3 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral Eye Irrit. 2 |
| | 3,5-Diisopropyl-4-hydroxybenzoic acid Usage And Synthesis |
| Uses | Propofol 4-Carboxylic acid is a related compound of Propofol (P829750), as an antioxidant. | | Uses | Propofol 4-Carboxylic Acid (Propofol EP Impurity N) is a related compound of Propofol (P829750), as an antioxidant. |
| | 3,5-Diisopropyl-4-hydroxybenzoic acid Preparation Products And Raw materials |
|