|
|
| | Aminoethylphosphinic acid Basic information |
| Product Name: | Aminoethylphosphinic acid | | Synonyms: | 1-aMinoethylphosphinic acid,Brillian-MB288;Phosphinic acid, P-(1-aminoethyl)-;(1-Aminoethyl)phosphinicaci;1-aMinoethyl-hydroxy-oxophosphanium;Cosmetic Pharmaceutical Chemicals Skin Whitening CAS 74333-44-1 Powder 99% Aminoethylphosphinic Acid;99% Aminoethylphosphinic Acid;(1-Aminoethyl)(hydroxy)(oxo)phosphonium;C2H8NO2P | | CAS: | 74333-44-1 | | MF: | C2H8NO2P | | MW: | 109.06 | | EINECS: | 000-000-0 | | Product Categories: | | | Mol File: | 74333-44-1.mol |  |
| | Aminoethylphosphinic acid Chemical Properties |
| Boiling point | 247.4±42.0 °C(Predicted) | | pka | 2.29±0.10(Predicted) | | Cosmetics Ingredients Functions | SKIN CONDITIONING | | InChI | InChI=1S/C2H8NO2P/c1-2(3)6(4)5/h2,6H,3H2,1H3,(H,4,5) | | InChIKey | TVKUNRSARHGLNB-UHFFFAOYSA-N | | SMILES | P(C(N)C)(O)=O |
| | Aminoethylphosphinic acid Usage And Synthesis |
| | Aminoethylphosphinic acid Preparation Products And Raw materials |
|