3-Methoxythiophene-2-carbaldehyde manufacturers
|
| | 3-Methoxythiophene-2-carbaldehyde Basic information |
| Product Name: | 3-Methoxythiophene-2-carbaldehyde | | Synonyms: | 3-Methoxythiophene-2-carbaldehyde;3-Methoxy-2-thiophenecarboxaldehyde;2-Formyl-3-methoxythiophene;2-Formyl-3-methoxythiophene, 3-Methoxy-2-thenaldehyde;2-Thiophenecarboxaldehyde,3-methoxy-;EOS-61858;OLIC-008;3-Methoxythiophene-2-carboxaldehyde,97% | | CAS: | 35134-07-7 | | MF: | C6H6O2S | | MW: | 142.18 | | EINECS: | 233-305-4 | | Product Categories: | | | Mol File: | 35134-07-7.mol |  |
| | 3-Methoxythiophene-2-carbaldehyde Chemical Properties |
| Melting point | 84℃ | | Boiling point | 255.8±20.0 °C(Predicted) | | density | 1.240±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | Appearance | White to off-white Solid | | Water Solubility | Slightly soluble in water. | | Sensitive | Air Sensitive | | InChI | InChI=1S/C6H6O2S/c1-8-5-2-3-9-6(5)4-7/h2-4H,1H3 | | InChIKey | KGJDTMQUUPIAEF-UHFFFAOYSA-N | | SMILES | C1(C=O)SC=CC=1OC |
| | 3-Methoxythiophene-2-carbaldehyde Usage And Synthesis |
| Uses | 3-Methoxythiophene-2-carboxaldehyde is used as a pharmaceutical intermediate. |
| | 3-Methoxythiophene-2-carbaldehyde Preparation Products And Raw materials |
|