- Cloquintocet
-
- $1.00 / 1KG
-
2020-02-20
- CAS:88349-88-6
- Min. Order: 1KG
- Purity: 98%HPLC
- Supply Ability: 10Tons
|
| | Cloquintocet Basic information |
| Product Name: | Cloquintocet | | Synonyms: | Cloquintocet;Cloquintocet PESTANAL;5-chloro-8-quinolinoxyacetic acid;cloquintocet (free acid);Herbicide Safener Cloquintocet;(5-Chloro-8-quinolyloxy)acetic acid;[(5-Chloro-8-quinolinyl)oxy]acetic acid;Cloquintocet [iso] | | CAS: | 88349-88-6 | | MF: | C11H8ClNO3 | | MW: | 237.64 | | EINECS: | 635-476-4 | | Product Categories: | | | Mol File: | 88349-88-6.mol |  |
| | Cloquintocet Chemical Properties |
| Boiling point | 435.0±30.0 °C(Predicted) | | density | 1.450 | | vapor pressure | 0-0Pa at 20-25℃ | | pka | 2.87±0.40(Predicted) | | Major Application | agriculture
environmental | | InChI | 1S/C11H8ClNO3/c12-8-3-4-9(16-6-10(14)15)11-7(8)2-1-5-13-11/h1-5H,6H2,(H,14,15) | | InChIKey | ICJSJAJWTWPSBD-UHFFFAOYSA-N | | SMILES | O=C(O)COC1=C(N=CC=C2)C2=C(Cl)C=C1 |
| Hazard Codes | Xn | | Risk Statements | 22 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Chronic 2 |
| | Cloquintocet Usage And Synthesis |
| Uses | Cloquintocet is a herbicidal composition that contains Pinoxaden(P469505). | | Definition | ChEBI: Cloquintocet is a member of the class of quinolines that is quinoline which is substituted by a chloro group at position 5 and by a carboxymethoxy group at position 8. It has a role as a herbicide safener. It is an aromatic ether, a monocarboxylic acid, an organochlorine compound and a member of quinolines. |
| | Cloquintocet Preparation Products And Raw materials |
|