| Company Name: |
Shanghai BeiZhuo Biotech Co., Ltd.
|
| Tel: |
021-61119791,13386096464 |
| Email: |
bzswkf@foxmail.com |
| Products Intro: |
Product Name:Alachlor OA, Pestanal
CAS:171262-17-2
Purity:99%HPLC
|
| Company Name: |
Alta Scientific Co., Ltd.
|
| Tel: |
022-6537-8550 15522853686 |
| Email: |
sales@altasci.com.cn |
| Products Intro: |
Product Name:Alachlor oxalamic acid (OA)
CAS:171262-17-2
Purity:99% Package:10mg;100mg;1g
|
|
| | Alachlor OA, Pestanal Basic information |
| Product Name: | Alachlor OA, Pestanal | | Synonyms: | Alachlor OA, Pestanal;N-(2,6-Diethylphenyl)-N-(methoxymethyl)oxalamic acid, [(2,6-Diethylphenyl)(methoxymethyl)amino]oxo-acetic acid;Alachlor oxalamic acid (OA);2-[(2,6-diethylphenyl)(methoxymethyl)amino]-2-oxoacetic acid;Acetic acid, 2-[(2,6-diethylphenyl)(methoxymethyl)amino]-2-oxo-;Alachlore OXA;Alachlor Metabolite 70;Alachlor OA 100 μg/ml Acetonitrile | | CAS: | 171262-17-2 | | MF: | C14H19NO4 | | MW: | 265.3 | | EINECS: | | | Product Categories: | | | Mol File: | 171262-17-2.mol |  |
| | Alachlor OA, Pestanal Chemical Properties |
| Boiling point | 398.4±52.0 °C(Predicted) | | density | 1.183±0.06 g/cm3(Predicted) | | pka | -0.06±0.54(Predicted) | | Major Application | agriculture
environmental | | InChI | 1S/C14H19NO4/c1-4-10-7-6-8-11(5-2)12(10)15(9-19-3)13(16)14(17)18/h6-8H,4-5,9H2,1-3H3,(H,17,18) | | InChIKey | MHCYOELBTPOBIU-UHFFFAOYSA-N | | SMILES | CCc1cccc(CC)c1N(COC)C(=O)C(O)=O | | EPA Substance Registry System | Acetic acid, 2-[(2,6-diethylphenyl)(methoxymethyl)amino]-2-oxo- (171262-17-2) |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | Alachlor OA, Pestanal Usage And Synthesis |
| Uses | Alachlor OA-D5 is an isotope labelled compound of Alachlor OA (A450808). Alachlor OA is a component of pesticide formulations used in the prevention of weed growth. | | Definition | ChEBI: Alachlor OXA is an oxo monocarboxylic acid that is oxoacetic acid substituted by a (2,6-diethylphenyl)(methoxymethyl)amino group at position 2. It is a metabolite of the herbicide alachlor. It has a role as a marine xenobiotic metabolite. It is an oxo monocarboxylic acid, an ether and an aromatic amide. |
| | Alachlor OA, Pestanal Preparation Products And Raw materials |
|