| Company Name: |
Energy Chemical
|
| Tel: |
021-021-58432009 400-005-6266 |
| Email: |
sales8178@energy-chemical.com |
| Products Intro: |
Product Name:trans-BroMo(N-succiniMidyl)bis(triphenylphosphine)palladiuM(II) CAS:251567-28-9 Purity:97% Package:1G
|
|
| | BROMOBIS(PH3P)(N-SUCCINIMIDE)PD(II) Basic information |
| Product Name: | BROMOBIS(PH3P)(N-SUCCINIMIDE)PD(II) | | Synonyms: | [Pd(NCOC2H4CO)(PPh3)2Br];BROMOBIS(PH3P)(N-SUCCINIMIDE)PD(II);bromo(n-succinimidyl)bis(triphenylphosphine)palladium(ii);trans-Bromo(N-succinimidyl)bis(triphenylphosphine)palladium(II);trans-BroMo(N-succiniMidyl)bis(triphenylphosphine)palladiuM(II),97%;bromopalladium, pyrrolidin-1-ide-2,5-dione, triphenylphospho...;BROMOBIS(PH3P)(N-SUCCINIMIDE)PD(II) BROMOBIS(PH3P)(N-SUCCINIMIDE)PD(II);trans-Bromo(N-succinimidyl)bis(triphenylphosphine)palladium(II) | | CAS: | 251567-28-9 | | MF: | C40H37BrNO2P2Pd | | MW: | 812.01 | | EINECS: | | | Product Categories: | | | Mol File: | 251567-28-9.mol |  |
| | BROMOBIS(PH3P)(N-SUCCINIMIDE)PD(II) Chemical Properties |
| Melting point | 223-228 °C (dec.) (lit.) | | form | solid | | InChI | 1S/2C18H15P.C4H5NO2.BrH.Pd/c2*1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;6-3-1-2-4(7)5-3;;/h2*1-15H;1-2H2,(H,5,6,7);1H;/q;;;;+2/p-2 | | InChIKey | KYQYWUJRFOCJEW-UHFFFAOYSA-L | | SMILES | Br[Pd]N1C(=O)CCC1=O.c2ccc(cc2)P(c3ccccc3)c4ccccc4.c5ccc(cc5)P(c6ccccc6)c7ccccc7 |
| WGK Germany | 3 | | Storage Class | 13 - Non Combustible Solids |
| | BROMOBIS(PH3P)(N-SUCCINIMIDE)PD(II) Usage And Synthesis |
| Uses | trans-Bromo(N-succinimidyl)bis(triphenylphosphine)palladium(II) may be used in the following processes:
- As a catalyst for the preparation of 6-cyano-2-(3-fluoro-benzyl)-indole-1-carboxylic acid tert-butyl ester via Suzuki cross-coupling reaction between 1-boc-6-cyanoindole-2-boronic acid and 3-fluorobenzyl bromide. This method does not involve the use of strong bases or toxic reagents and also the use of this catalyst minimizes protodeboronation.
- As a precatalyst for the Suzuki-Miyaura cross-coupling reaction between alkenyl tosylates and alkenyl MIDA boronates in the absence of phosphine ligands. For less activated alkenyl tosylate, the addition of tricyclohexylphosphine tetrafluoroborate improves the reactivity.
| | reaction suitability | core: palladium reaction type: Buchwald-Hartwig Cross Coupling Reaction reaction type: Cross Couplings reaction type: Heck Reaction reaction type: Hiyama Coupling reaction type: Negishi Coupling reaction type: Sonogashira Coupling reaction type: Stille Coupling reaction type: Suzuki-Miyaura Coupling reagent type: catalyst |
| | BROMOBIS(PH3P)(N-SUCCINIMIDE)PD(II) Preparation Products And Raw materials |
|