|
|
| | 4,4'-Bis((4-bromophenyl)phenylamino)bip& Basic information |
| Product Name: | 4,4'-Bis((4-bromophenyl)phenylamino)bip& | | Synonyms: | N4,N4'-bis(4-broMophenyl)-N4,N4'-diphenylbiphenyl-4,4'-diaMine;4,4'-Bis[(p-bromophenyl)phenylamino]biphenyl;N,N'-Diphenyl-N,N'-bis(4-bromophenyl)biphenyl-4,4'-diamine;N,N'-Bis(4-bromophenyl)-N,N'-diphenyl-4,4'-biphenyldiamine;[1,1'-Biphenyl]-4,4'-diamine, N4,N4'-bis(4-bromophenyl)-N4,N4'-diphenyl-;4,4'-Bis[(4-bromophenyl)phenylamino]biphenyl 97%;4,4'-bis((4-bromophenyl)phenylamino)bip;N4,N4'-Bis(4-bromophenyl)-N4,N4'-diphenyl-[1,1'-biphenyl]-4,4'-diamine | | CAS: | 344782-48-5 | | MF: | C36H26Br2N2 | | MW: | 646.41 | | EINECS: | | | Product Categories: | Organic Electronics and Photonics;Synthetic Intermediates;Synthetic Tools and Reagents | | Mol File: | 344782-48-5.mol |  |
| | 4,4'-Bis((4-bromophenyl)phenylamino)bip& Chemical Properties |
| Melting point | 103-135 °C (polymorphic) | | Boiling point | 721.8±60.0 °C(Predicted) | | density | 1.438±0.06 g/cm3(Predicted) | | pka | -3.33±0.60(Predicted) | | form | solid | | InChI | 1S/C36H26Br2N2/c37-29-15-23-35(24-16-29)39(31-7-3-1-4-8-31)33-19-11-27(12-20-33)28-13-21-34(22-14-28)40(32-9-5-2-6-10-32)36-25-17-30(38)18-26-36/h1-26H | | InChIKey | KKZPWVLMUUASEA-UHFFFAOYSA-N | | SMILES | Brc1ccc(cc1)N(c2ccccc2)c3ccc(cc3)-c4ccc(cc4)N(c5ccccc5)c6ccc(Br)cc6 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 4,4'-Bis((4-bromophenyl)phenylamino)bip& Usage And Synthesis |
| | 4,4'-Bis((4-bromophenyl)phenylamino)bip& Preparation Products And Raw materials |
|