|
|
| | FMOC-L-2-NITROPHENYLALANINE Basic information |
| | FMOC-L-2-NITROPHENYLALANINE Chemical Properties |
| Boiling point | 672.7±55.0 °C(Predicted) | | density | 1.371±0.06 g/cm3 (20 ºC 760 Torr) | | storage temp. | 2-8°C | | solubility | DMF (Slightly), DMSO (Slightly), Methanol (Slightly) | | pka | 3.58±0.11(Predicted) | | form | solid | | Major Application | peptide synthesis | | InChIKey | KVLRWXBYPKSBFY-NRFANRHFSA-N | | SMILES | [N+](=O)([O-])c1c(cccc1)C[C@H](NC(=O)OCC2c3c(cccc3)c4c2cccc4)C(=O)O | | CAS DataBase Reference | 210282-30-7(CAS DataBase Reference) |
| Hazard Codes | Xi | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 2924297099 | | Storage Class | 11 - Combustible Solids |
| | FMOC-L-2-NITROPHENYLALANINE Usage And Synthesis |
| Uses | Fmoc-L-2-nitrophenylalanine can be useful in wavelength-selective uncaging of two different photoresponsive groups on one effector molecule for light-controlled activation and deactivation. | | reaction suitability | reaction type: Fmoc solid-phase peptide synthesis |
| | FMOC-L-2-NITROPHENYLALANINE Preparation Products And Raw materials |
|