| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 4-Benzylthiophenylboronic acid Basic information |
| Product Name: | 4-Benzylthiophenylboronic acid | | Synonyms: | 4-(BENZYLSULFANYL)PHENYLBORONIC ACID;AKOS BRN-0551;Boronic acid, B-[4-[(phenylmethyl)thio]phenyl]-;B-[4-[(Phenylmethyl)thio]phenyl]boronic acid;4-(Benzylthio)benzeneboronic acid;4-Benzylthiophenylboronic acid - [B2404];B-[4-[(Benzyl)thio]phenyl]boronic acid;4-Benzylthiophenylboronic acid | | CAS: | 1005207-32-8 | | MF: | C13H13BO2S | | MW: | 244.12 | | EINECS: | | | Product Categories: | | | Mol File: | Mol File |  |
| | 4-Benzylthiophenylboronic acid Chemical Properties |
| Melting point | 148-149 °C(Solv: hexane (110-54-3)) | | Boiling point | 435.4±55.0 °C(Predicted) | | density | 1.23±0.1 g/cm3(Predicted) | | pka | 8.52±0.17(Predicted) | | form | solid | | InChI | 1S/C13H13BO2S/c15-14(16)12-6-8-13(9-7-12)17-10-11-4-2-1-3-5-11/h1-9,15-16H,10H2 | | InChIKey | ALXFJPATEOZQPF-UHFFFAOYSA-N | | SMILES | OB(O)C(C=C1)=CC=C1SCC2=CC=CC=C2 |
| Hazard Codes | Xi | | Risk Statements | 36 | | Safety Statements | 26 | | WGK Germany | WGK 3 | | HS Code | 2934999090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 |
| | 4-Benzylthiophenylboronic acid Usage And Synthesis |
| | 4-Benzylthiophenylboronic acid Preparation Products And Raw materials |
|