|
|
| | 1-Methyl-1-tosylmethyl isocyanide Basic information | | Uses |
| Product Name: | 1-Methyl-1-tosylmethyl isocyanide | | Synonyms: | 1-(1-isocyanoethylsulfonyl)-4-methylbenzene;Benzene, 1-[(1-isocyanoethyl)sulfonyl]-4-methyl-;1-tosylethyl isocyanide;methyl-TOSMIC;1-METHYL-1-TOSYLMETHYL ISOCYANIDE ISO 9001:2015 REACH;1-Isocyanoethyl 4-methylphenyl sulfone;1-(1-isocyanoethylsulfonyl)-4-methyl-benzene - [K72435];1-Methyl-1-tosylmethyl isocyanide | | CAS: | 58379-80-9 | | MF: | C10H11NO2S | | MW: | 209.26 | | EINECS: | | | Product Categories: | | | Mol File: | 58379-80-9.mol |  |
| | 1-Methyl-1-tosylmethyl isocyanide Chemical Properties |
| Melting point | 46 °C | | storage temp. | Storage temp. -20°C | | form | solid | | color | Pale yellow | | InChI | InChI=1S/C10H11NO2S/c1-8-4-6-10(7-5-8)14(12,13)9(2)11-3/h4-7,9H,1-2H3 | | InChIKey | NGOUPILQFWOEET-UHFFFAOYSA-N | | SMILES | S(=O)(=O)(C1C=CC(C)=CC=1)C(C)[N+]#[C-] |
| | 1-Methyl-1-tosylmethyl isocyanide Usage And Synthesis |
| Uses | It is an intermediate widely used in organic synthesis, especially in the synthesis of five-membered organic heterocyclic compounds, and has been applied in the synthesis of pharmaceuticals and other fine chemical products. |
| | 1-Methyl-1-tosylmethyl isocyanide Preparation Products And Raw materials |
|