- (S)-Cbz-Phenylalaninol
-
- $0.00 / 25Kg/Drum
-
2026-04-28
- CAS:6372-14-1
- Min. Order: 1KG
- Purity: 98%min
- Supply Ability: 1000kg
|
| | (S)-Cbz-Phenylalaninol Basic information |
| | (S)-Cbz-Phenylalaninol Chemical Properties |
| Melting point | 92-95 °C | | alpha | -45 º (c=2, MeOH) | | Boiling point | 427.77°C (rough estimate) | | density | 1.0864 (rough estimate) | | refractive index | -42 ° (C=2, MeOH) | | storage temp. | Sealed in dry,2-8°C | | solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. | | pka | 11.86±0.46(Predicted) | | form | powder to crystal | | color | White to Almost white | | Optical Rotation | [α]20/D 30°, c = 1 in chloroform | | Water Solubility | insoluble | | BRN | 2816420 | | Major Application | peptide synthesis | | InChI | 1S/C17H19NO3/c19-12-16(11-14-7-3-1-4-8-14)18-17(20)21-13-15-9-5-2-6-10-15/h1-10,16,19H,11-13H2,(H,18,20)/t16-/m0/s1 | | InChIKey | WPOFMMJJCPZPAO-INIZCTEOSA-N | | SMILES | OC[C@H](Cc1ccccc1)NC(=O)OCc2ccccc2 | | CAS DataBase Reference | 6372-14-1(CAS DataBase Reference) |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | F | 10-23 | | HS Code | 29051990 | | Storage Class | 11 - Combustible Solids |
| | (S)-Cbz-Phenylalaninol Usage And Synthesis |
| Chemical Properties | white powder | | Uses | Employed in the synthesis of biochemically active compounds. Building block for the synthesis of HIV protease inhibitors. | | reaction suitability | reaction type: solution phase peptide synthesis |
| | (S)-Cbz-Phenylalaninol Preparation Products And Raw materials |
|