- Huperzine B
-
- $37.00 / 1mg
-
2025-10-21
- CAS:103548-82-9
- Min. Order:
- Purity: 99.83%
- Supply Ability: 10g
- Huperzine B
-
- $0.00 / 20mg
-
2023-02-24
- CAS:103548-82-9
- Min. Order: 20mg
- Purity: ≥98%(HPLC)
- Supply Ability: 100 g
- Huperzine B
-
- $90.00 / 1kg
-
2023-02-13
- CAS:103548-82-9
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 80MT
|
| | Huperzine B Basic information | | Uses |
| Product Name: | Huperzine B | | Synonyms: | HuperzineB;12-Methyl-2,3,4,4a,5,6-hexahydro-1H-5,10b-prop[1]eno-1,7-phenanthrolin-8(7H)-one;8,15-Didehydrolycodin-1(18H)-one;1H-5,10b-Propeno-1,7-phenanthrolin-8(7H)-one, 2,3,4,4a,5,6-hexahydro-12-methyl-, (4aR,5R,10bR)-;Huperzine B USP/EP/BP;(4aR,5R,10bR)-12-Methyl-2,3,4,4a,5,6-hexahydro-1H-5,10b-prop[1]eno-1,7-phenanthrolin-8(7H)-one;Huperzine B-RM | | CAS: | 103548-82-9 | | MF: | C16H20N2O | | MW: | 256.34 | | EINECS: | | | Product Categories: | reference substance | | Mol File: | 103548-82-9.mol |  |
| | Huperzine B Chemical Properties |
| Boiling point | 533.5±50.0 °C(Predicted) | | density | 1.21±0.1 g/cm3(Predicted) | | storage temp. | Store at -20°C | | solubility | DMF:1.0(Max Conc. mg/mL);3.9(Max Conc. mM)
DMSO:1.0(Max Conc. mg/mL);3.9(Max Conc. mM)
Ethanol:2.0(Max Conc. mg/mL);7.8(Max Conc. mM) | | form | A solid | | pka | 12.92±0.40(Predicted) | | color | White to off-white | | InChI | InChI=1/C16H20N2O/c1-10-7-11-8-14-13(4-5-15(19)18-14)16(9-10)12(11)3-2-6-17-16/h4-5,7,11-12,17H,2-3,6,8-9H2,1H3,(H,18,19)/t11-,12+,16+/s3 | | InChIKey | YYWGABLTRMRUIT-YQLZAFFXNA-N | | SMILES | [C@@]123NCCC[C@]1([H])[C@]([H])(CC1NC(=O)C=CC2=1)C=C(C)C3 |&1:0,5,7,r| |
| | Huperzine B Usage And Synthesis |
| Uses | Huperzine B is a plant-derived alkaloid displaying anti-cholinesterase activity. | | Chemical Properties | White crystalline powder, soluble in methanol, ethanol, DMSO and other organic solvents, derived from Melaleuca alternifolia, Huperzia serrata, and Cryptomeria japonica. | | Uses | Huperzine B is a plant-derived alkaloid displaying anti-cholinesterase activity. | | Definition | ChEBI: Huperzine b is a phenanthrol. |
| | Huperzine B Preparation Products And Raw materials |
|