- Dimethenamid
-
- $1.00 / 1KG
-
2020-02-20
- CAS:87674-68-8
- Min. Order: 1KG
- Purity: 98%HPLC
- Supply Ability: 10Tons
|
| | Dimethenamid Basic information |
| | Dimethenamid Chemical Properties |
| Melting point | 25°C | | Boiling point | bp26.7 Pa 127° | | density | d25 1.187 | | refractive index | 1.5630 (estimate) | | storage temp. | 0-6°C | | solubility | Chloroform (Slightly), DMSO (Slightly), Ethyl Acetate (Slightly), Methanol (Slightly) | | pka | 1.16±0.50(Predicted) | | Merck | 13,3240 | | BRN | 8143313 | | Major Application | agriculture environmental | | InChI | 1S/C12H18ClNO2S/c1-8-7-17-10(3)12(8)14(11(15)5-13)9(2)6-16-4/h7,9H,5-6H2,1-4H3 | | InChIKey | JLYFCTQDENRSOL-UHFFFAOYSA-N | | SMILES | COCC(C)N(C(=O)CCl)c1c(C)csc1C | | EPA Substance Registry System | Dimethenamid (87674-68-8) |
| Hazard Codes | Xn,N | | Risk Statements | 22-51/53 | | RIDADR | UN 3082 9 / PGIII | | WGK Germany | 2 | | RTECS | AB5444200 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Acute Tox. 4 Oral Aquatic Chronic 2 | | Hazardous Substances Data | 87674-68-8(Hazardous Substances Data) | | Toxicity | LD50 in rats (mg/kg): 1570 orally; >2000 dermally; LC50 in bluegill sunfish, rainbow trout (mg/l): 6.4, 2.6 (Harr) |
| | Dimethenamid Usage And Synthesis |
| Uses | Preemergence herbicide for use in food crops. | | Definition | ChEBI: 2-chloro-N-(2,4-dimethylthiophen-3-yl)-N-(1-methoxypropan-2-yl)acetamide is an organochlorine compound that is 2-chloroacetamide substituted by a 2,4-dimethylthiophen-3-yl and a 1-methoxypropan-2-yl group at the nitrogen atom. It is a member of thiophenes, an aromatic amide, an ether and an organochlorine compound. | | Agricultural Uses | Herbicide: A U.S. EPA restricted Use Pesticide (RUP) as
Dimethenamide-P. Not approved for use in EU countries | | Trade name | DETAIL®; DPX-PM082® (formulation
containing dimethenamid, chlorimuron-ethyl, and so-
dium sulforicinol); FRONTIER®; GUARDSMAN®;
LEADOFF® (atrazine + dimethenamid), DuPont TM Crop
Protection; PURSUIT®; OPTILL®; SAN-582H® |
| | Dimethenamid Preparation Products And Raw materials |
|