|
|
| | (10-Phenylanthracen-9-yl)boronic acid Basic information |
| | (10-Phenylanthracen-9-yl)boronic acid Chemical Properties |
| Boiling point | 521.3±53.0 °C(Predicted) | | density | 1.27 | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | Soluble in methanol. | | form | Solid | | pka | 8.59±0.30(Predicted) | | color | White to Almost white | | Sensitive | Light Sensitive | | InChI | InChI=1S/C20H15BO2/c22-21(23)20-17-12-6-4-10-15(17)19(14-8-2-1-3-9-14)16-11-5-7-13-18(16)20/h1-13,22-23H | | InChIKey | RVPCPPWNSMAZKR-UHFFFAOYSA-N | | SMILES | B(C1C2=CC=CC=C2C(C2=CC=CC=C2)=C2C=1C=CC=C2)(O)O |
| | (10-Phenylanthracen-9-yl)boronic acid Usage And Synthesis |
| Chemical Properties | white powder | | Uses |
(10-Phenylanthracen-9-yl)boronic acid is used as pharmaceutical intermediate and as OLED materials.
| | Uses | suzuki reaction | | Synthesis |
The synthesis method of (10-phenylanthracene-9-yl)boronic acid is as follows: Starting from 9-bromo-10-phenylanthracene, the bromine atom on the anthracene ring is removed under the action of a strong base to obtain the corresponding aryl lithium reagent, which is then added with trimethyl borate or triisopropyl borate and hydrolyzed to obtain the product.
|
| | (10-Phenylanthracen-9-yl)boronic acid Preparation Products And Raw materials |
|